{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 396883483 | IUPAC_name = 2,7-Bis(2-diethylaminoethoxy)fluoren-9-one | image = Tilorone.svg | image_class = skin-invert-image | width = 275
<!--Clinical data--> | tradename = | Drugs.com = {{drugs.com|international|tilorone}} | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration = By mouth (tablets)
<!--Pharmacokinetic data--> | bioavailability = 60% | protein_bound = ~80% | metabolism = Nil | elimination_half-life = 48 hours | excretion = Feces (70%), urine (9%)<ref>{{cite web|title=Registry of Medicinal Products (RLS). Tilorone: Prescribing Information|url=http://www.rlsnet.ru/mnn_index_id_2731.htm|access-date=2 October 2016|language=Russian}}</ref>
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 27591-97-5 | ATC_prefix = J05 | ATC_suffix = AX19 | PubChem = 5475 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | UNII_Ref = {{fdacite|changed|FDA}} | UNII = O6W7VEW6KS | ChEBI = 147347 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 47298 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 5276 | KEGG_Ref = {{keggcite|changed|kegg}} | KEGG = D06149
<!--Chemical data--> | C=25 | H=34 | N=2 | O=3 | smiles = CCN(CC)CCOc1ccc-2c(c1)C(=O)c3c2ccc(c3)OCCN(CC)CC | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C25H34N2O3/c1-5-26(6-2)13-15-29-19-9-11-21-22-12-10-20(30-16-14-27(7-3)8-4)18-24(22)25(28)23(21)17-19/h9-12,17-18H,5-8,13-16H2,1-4H3 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = MPMFCABZENCRHV-UHFFFAOYSA-N }}
'''Tilorone''' (trade names '''Amixin''', '''Lavomax''' and others) is the first recognized synthetic, small molecular weight compound that is an orally active interferon inducer.<ref name="stringfellow">{{cite journal | vauthors = Stringfellow DA, Glasgow LA | title = Tilorone hydrochloride: an oral interferon-inducing agent | journal = Antimicrobial Agents and Chemotherapy | volume = 2 | issue = 2 | pages = 73–78 | date = August 1972 | pmid = 4670490 | pmc = 444270 | doi = 10.1128/aac.2.2.73 }}</ref> It is used as an antiviral drug in some countries which do not require double-blind placebo-controlled studies, including Russia. It is effective against Ebola virus in mice.<ref>{{cite journal | vauthors = Ekins S, Lingerfelt MA, Comer JE, Freiberg AN, Mirsalis JC, O'Loughlin K, Harutyunyan A, McFarlane C, Green CE, Madrid PB | display-authors = 6 | title = Efficacy of Tilorone Dihydrochloride against Ebola Virus Infection | journal = Antimicrobial Agents and Chemotherapy | volume = 62 | issue = 2 | date = February 2018 | pmid = 29133569 | pmc = 5786809 | doi = 10.1128/AAC.01711-17 }}</ref> It shows activity against Eastern equine encephalitis and related viruses.<ref name="pmid36851628">{{cite journal | vauthors = Ogorek TJ, Golden JE | title = Advances in the Development of Small Molecule Antivirals against Equine Encephalitic Viruses | journal = Viruses | volume = 15 | issue = 2 | date = February 2023 | page = 413 | pmid = 36851628 | pmc = 9958955 | doi = 10.3390/v15020413 | doi-access = free }}</ref>
==Pharmacology== Tilorone activates the production of interferon.<ref name="stringfellow" />
==See also== * Cyclic adenosine-inosine monophosphate
== References == {{Reflist}}
Category:Antiviral drugs Category:Fluorenones Category:Phenol ethers Category:Diethylamino compounds
{{antiinfective-drug-stub}}