{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 376122925 | IUPAC_name = [(1''S'',2''R'',3''S'',4''S'',6''R'',7''R'',8''R'',14''R'')-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.0<sup>1,8</sup>]tetradecanyl] 2-[2-(diethylamino)ethylsulfanyl]acetate | image = Tiamulin skeletal.svg | image_class = skin-invert-image | width =
<!--Clinical data--> | tradename = Dynamutilin, others | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = Veterinary use only | routes_of_administration = Oral
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 55297-95-5 | ATCvet = yes | ATC_prefix = J01 | ATC_suffix = XQ01 | ATC_supplemental = | PubChem = 656958 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | UNII_Ref = {{fdacite|changed|FDA}} | UNII = E38WZ4U54R | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 498466 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 44137 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 571196
<!--Chemical data--> | chemical_formula = | C=28 | H=47 | N=1 | O=4 | S=1 | smiles = CCN(CC)CCSCC(=O)O[C@@H]1C[C@@]([C@H]([C@@H]([C@@]23CC[C@H]([C@@]1([C@@H]2C(=O)CC3)C)C)C)O)(C)C=C | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C28H47NO4S/c1-8-26(6)17-22(33-23(31)18-34-16-15-29(9-2)10-3)27(7)19(4)11-13-28(20(5)25(26)32)14-12-21(30)24(27)28/h8,19-20,22,24-25,32H,1,9-18H2,2-7H3/t19-,20+,22-,24+,25+,26-,27+,28+/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = UURAUHCOJAIIRQ-QGLSALSOSA-N }} '''Tiamulin''' (previously '''thiamutilin''') is a pleuromutilin antibiotic drug that is used in veterinary medicine particularly for pigs and poultry.<ref>{{cite web | url = http://www.bioagrimix.com/haccp/html/tiamulin.htm | work = HACCP | title = Tiamulin in Veterinary Medicine | archive-url = https://web.archive.org/web/20090610080725/http://www.bioagrimix.com/haccp/html/tiamulin.htm | archive-date=2009-06-10 }}</ref><ref>{{cite journal | vauthors = Long KS, Hansen LH, Jakobsen L, Vester B | title = Interaction of pleuromutilin derivatives with the ribosomal peptidyl transferase center | journal = Antimicrobial Agents and Chemotherapy | volume = 50 | issue = 4 | pages = 1458–62 | date = April 2006 | pmid = 16569865 | pmc = 1426994 | doi = 10.1128/AAC.50.4.1458-1462.2006 | url = }}</ref>
Tiamulin is a diterpene antimicrobial with a pleuromutilin chemical structure similar to that of valnemulin.<ref>{{cite web | url = http://www.emea.europa.eu/pdfs/vet/mrls/074700en.pdf | work = EMEA | title = Tiamulin Summary Report }}</ref>
== References == {{reflist}}
{{Other antibacterials}}
Category:Pleuromutilin antibiotics Category:Secondary alcohols Category:Cyclic ketones Category:Carboxylate esters Category:Thioethers Category:Cyclopentanes Category:Diethylamino compounds Category:Vinyl compounds
{{antibiotic-stub}}