{{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 470609845 | ImageFile = Thyronamine.svg | ImageClass = skin-invert-image | ImageSize = 200px | ImageFile2 = Thyronamine3d.png | ImageClass2 = bg-transparent | ImageSize2 = 200px | PIN = 4-[4-(2-Aminoethyl)phenoxy]phenol | OtherNames = |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 2340781 | InChI = 1/C14H15NO2/c15-10-9-11-1-5-13(6-2-11)17-14-7-3-12(16)4-8-14/h1-8,16H,9-10,15H2 | InChIKey = OVUVNKDANCKDCK-UHFFFAOYAP | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 201896 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C14H15NO2/c15-10-9-11-1-5-13(6-2-11)17-14-7-3-12(16)4-8-14/h1-8,16H,9-10,15H2 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = OVUVNKDANCKDCK-UHFFFAOYSA-N | CASNo_Ref = {{cascite|changed|??}} | CASNo = 500-78-7 | PubChem = 3083601 | SMILES = O(c1ccc(cc1)CCN)c2ccc(O)cc2 | MeSHName = thyronamine }} |Section2={{Chembox Properties | C=14 | H=15 | N=1 | O=2 | Appearance = | Density = | MeltingPt = | BoilingPt = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Thyronamine''' is a type of decarboxylated and deiodinated metabolite of the thyroid hormones thyroxine (T4) and 3,5,3'-triiodothyronine (T3). The word '''thyronamine''' can refer to either the family of molecules, or the specific molecule from which they are derived.
==Types== The group includes:
* Thyronamine (T0AM) * 3-Iodothyronamine (T1AM), which is the most notable one as it is a trace amine found in the nervous system. It is a possible candidate for the natural ligand of the trace amine-associated receptor TAAR1 (TAR1), an intracellular G protein-coupled receptor<ref>{{cite journal | vauthors = Piehl S, Hoefig CS, Scanlan TS, Köhrle J | year = 2011 | title = Thyronamines - Past, Present, and Future | journal = Endocrine Reviews | volume = 32 | pages = 64–80 | doi = 10.1210/er.2009-0040 | pmid = 20880963 | issue = 1| doi-access = free }}</ref> * 3,5-Diiodothyronamine (T2AM) * 3,5,3'-Triiodothyronamine (T3AM)
==See also== * Trace amines * Thyroid hormone
==References== {{Reflist}}
{{Thyroid hormone intermediates}} {{TAAR ligands}} {{Phenethylamines}}
Category:Biogenic amines Category:Methoxyphenethylamines Category:4-Hydroxyphenyl compounds Category:Thyroid Category:TAAR1 agonists Category:Aminoethyl compounds