{{Chembox | ImageFile = Thujopsene.svg | ImageSize = | PIN = (1a''S'',4a''S'',8a''S'')-2,4a,8,8-Tetramethyl-1,1a,4,4a,5,6,7,8-octahydrocyclopropa[''d'']naphthalene | OtherNames = Sesquichamene; Thujopsen; Widdrene |Section1={{Chembox Identifiers | CASNo = 470-40-6 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = E116U47P7N | PubChem = 442402 | ChEBI = 9578 | ChemSpiderID = 390845 | SMILES = C\2=C(\[C@H]3[C@@]1([C@](CCCC1(C)C)(C)C/2)C3)C | InChI = 1/C15H24/c1-11-6-9-14(4)8-5-7-13(2,3)15(14)10-12(11)15/h6,12H,5,7-10H2,1-4H3/t12-,14-,15-/m0/s1 | InChIKey = WXQGPFZDVCRBME-QEJZJMRPBP | StdInChI = 1S/C15H24/c1-11-6-9-14(4)8-5-7-13(2,3)15(14)10-12(11)15/h6,12H,5,7-10H2,1-4H3/t12-,14-,15-/m0/s1 | StdInChIKey = WXQGPFZDVCRBME-QEJZJMRPSA-N }} |Section2={{Chembox Properties | C=15 | H=24 | Appearance = | Density = 0.936 g/mL (20 °C)<ref name=Aldrich>{{cite web | url = http://www.sigmaaldrich.com/catalog/product/aldrich/89235?lang=en | publisher = Sigma-Aldrich | title = (−)-Thujopsene}}</ref> | MeltingPt = | BoilingPtC = 258 to 260 | BoilingPt_ref = <ref name=Aldrich/> | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Thujopsene''' is a natural chemical compound, classified as a sesquiterpene, with the molecular formula C<sub>15</sub>H<sub>24</sub>.
Thujopsene is found in the essential oil of a variety of conifers,<ref>{{cite journal | title = Structure of thujopsene and hinokiic acid from coniferous wood |author1=Erdtman, H. |author2=Norin, T. | journal = Chemistry and Industry | year = 1960 | issue = 22 | pages = 622–623}}</ref> in particular ''Juniperus cedrus'' and ''Thujopsis dolabrata'' in which it comprises around 2.2% of the weight of the heartwood.<ref name="Runeburg1960b">{{cite journal | last1=Runeburg | first1=Jarl | year=1960 | title=The Chemistry of the Natural Order Cupressales XXX. Constituents of ''Juniperus cedrus L.'' | journal=Acta Chemica Scandinavica | volume=14 | pages=1991–1994 | doi=10.3891/acta.chem.scand.14-1991 | last2=Gramstad | first2=Thor | last3=Larsson | first3=Lennart | last4=Dodson | first4=R. M. | doi-access=free }}</ref>
==Biosynthesis== Thujopsene is biosynthesized from farnesyl pyrophosphate (FPP):<ref>{{cite book| author = J. Mann| title = Natural Products: their chemistry and biological significance| isbn = 978-0582060098| display-authors = etal| url-access = registration| url = https://archive.org/details/isbn_9780582060098| year = 1994| publisher = Longman Scientific & Technical}}</ref>
:500px
==References== {{reflist}}
Category:Hydrocarbons Category:Sesquiterpenes Category:Cyclopropanes Category:Tricyclic compounds