{{Chembox | ImageFile = Th(C2O4)2(H2O)4 (249614).png | ImageSize = | ImageAlt = | IUPACName = | OtherNames = | Section1 = {{Chembox Identifiers | CASNo = 2040-52-0 | ChemSpiderID = 23350268 | PubChem = 74880 | EINECS = 218-038-3 | StdInChI=1S/2C2H2O4.Th/c2*3-1(4)2(5)6;/h2*(H,3,4)(H,5,6); | StdInChIKey = MVVXFNGAKVVFBW-UHFFFAOYSA-N | SMILES = C(=O)(C(=O)O)O.C(=O)(C(=O)O)O.[Th] }} | Section2 = {{Chembox Properties | C=4|O=8|Th=1 | Appearance = | Density = 4.637 g/cm<sup>3</sup> (anhydrous) | MolarMass = 408.07 g/mol<br/> 444.114 g/mol (dihydrate) | MeltingPt = | BoilingPt = | SolubilityProduct = 5.01{{resx}}10<sup>−25</sup> }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Thorium oxalate''' is the inorganic compound with the formula Th(C<sub>2</sub>O<sub>4</sub>)<sub>2</sub>(H<sub>2</sub>O)<sub>4</sub>. It is a white insoluble solid prepared by the reaction of thorium(IV) salts with oxalic acid.<ref>Enver Oktay, Ahmet Yayli (2001) [http://www.sciencedirect.com/science/article/pii/S0022311500005717 ''Physical properties of thorium oxalate powders and their influence on the thermal decomposition''] Journal of Nuclear Materials Volume 288, Issue 1, January 2001, Pages 76–82</ref> The material is a coordination polymer. Each Th(IV) center is bound to 10 oxygen centers: eight provided by the bridging oxalates and two by a pair of aquo ligands. Two additional waters of hydration are observed in the lattice.<ref>{{cite journal |doi=10.1016/j.jssc.2007.12.008|title=Hydrothermal Chemistry of Th(IV) with Aromatic dicarboxylates: New Framework Compounds and in Situ Ligand Syntheses|year=2008|last1=Ziegelgruber|first1=Kate L.|last2=Knope|first2=Karah E.|last3=Frisch|first3=Mark|last4=Cahill|first4=Christopher L.|journal=Journal of Solid State Chemistry|volume=181|issue=2|pages=373–381|bibcode=2008JSSCh.181..373Z}}</ref>

The solubility product (K<sub>sp</sub>) of thorium oxalate is 5.01{{resx}}10<sup>−25</sup>.<ref>Taishi Kobayashi, Takayuki Sasaki, Ikuji Takagi, Hirotake Moriyama (2009) [http://www.tandfonline.com/doi/abs/10.1080/18811248.2009.9711619 ''Solubility of Thorium(IV) in the Presence of Oxalic and Malonic Acids''] Journal of Nuclear Science and Technology, Vol. 46, No. 11, p. 1085–1090</ref> The density of anhydrous thorium oxalate is 4.637 g/cm<sup>3</sup>.

==References== {{Reflist}}

==External links== * [http://thorium.atomistry.com/thorium_oxalate.html Atomistry.com: Thorium oxalate info page] * [http://ibilabs.com/uranium-uranyl-thorium-compounds/thorium-compounds/thorium-oxalate-dihydrate/ International Bio-Analytical Industries: Thorium Oxalate Dihydrate]

{{Thorium compounds}} {{Oxalates}}

Category:Thorium(IV) compounds Category:Oxalates

{{inorganic-compound-stub}}