{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = 1-methyl-10-[2-(4-methylpiperazin-1-yl)acetyl]-5''H''-thieno[3,4-''b''][1,5]benzodiazepin-4-one | image = Telenzepine.svg | image_class = skin-invert-image | width = 190
<!--Clinical data--> | tradename = | pregnancy_category = | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number = 80880-90-6 | ATC_prefix = None | ATC_suffix = | PubChem = 5387 | DrugBank = | ChemSpiderID = 5194 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 0990EG3K10 | ChEMBL = 253978
<!--Chemical data--> |C=19 |H=22 |N=4 |O=2 |S=1
| smiles = C1CN(C)CCN1CC(=O)N2c3ccccc3NC(=O)c4csc(C)c42 | StdInChI = 1S/C19H22N4O2S/c1-13-18-14(12-26-13)19(25)20-15-5-3-4-6-16(15)23(18)17(24)11-22-9-7-21(2)8-10-22/h3-6,12H,7-11H2,1-2H3,(H,20,25) | StdInChIKey = VSWPGAIWKHPTKX-UHFFFAOYSA-N }}
'''Telenzepine''' is a thienobenzodiazepine acting as selective M<sub>1</sub> antimuscarinic. It is used in the treatment of peptic ulcers.<ref name=Eveleigh>{{cite journal | vauthors = Eveleigh P, Hulme EC, Schudt C, Birdsall NJ | title = The existence of stable enantiomers of telenzepine and their stereoselective interaction with muscarinic receptor subtypes | journal = Molecular Pharmacology | volume = 35 | issue = 4 | pages = 477–83 | date = April 1989 | doi = 10.1016/S0026-895X(25)11262-5 | pmid = 2704371 }}</ref> Telenzepine is atropisomeric, in other words the molecule has a stereogenic C–N-axis. In neutral aqueous solution it displays a half-life for racemization of the order of 1000 years. The enantiomers have been resolved. The activity is related to the (+)-isomer which is about 500-fold more active than the (–)-isomer at muscarinic receptors in the rat cerebral cortex.<ref name=Clayden>{{cite journal | vauthors = Clayden J, Moran WJ, Edwards PJ, LaPlante SR | title = The challenge of atropisomerism in drug discovery | journal = Angewandte Chemie | volume = 48 | issue = 35 | pages = 6398–401 | year = 2009 | pmid = 19637174 | doi = 10.1002/anie.200901719 | bibcode = 2009ACIE...48.6398C }}</ref>
== See also == * Pirenzepine
== References == {{Reflist}}
== External links == {{refbegin}} * {{cite journal | vauthors = Londong W, Londong V, Meierl A, Voderholzer U | title = Telenzepine is at least 25 times more potent than pirenzepine--a dose response and comparative secretory study in man | journal = Gut | volume = 28 | issue = 7 | pages = 888–95 | date = July 1987 | pmid = 3653758 | pmc = 1433086 | doi = 10.1136/gut.28.7.888 }} {{refend}}
{{Muscarinic acetylcholine receptor modulators}} {{Tricyclics}} {{Benzodiazepines}} {{Drugs for peptic ulcer and GORD}}
Category:4-Methylpiperazin-1-yl compounds Category:Carboxamides Category:Lactams Category:M1 receptor antagonists Category:Thienobenzodiazepines
{{gastrointestinal-drug-stub}}