{{Short description|Chemical compound}} {{distinguish|Teixobactin}}
{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 470478033 | IUPAC_name = (2''S'',3''S'',5''R'')-3-Methyl-7-oxo-3-(1''H''-1,2,3-triazol-1-ylmethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide | image = Tazobactam structure.svg | image_class = skin-invert-image | image2 = Tazobactam-from-xtal-3D-bs-17.png | image_class2 = bg-transparent
<!--Clinical data--> | tradename = | Drugs.com = {{drugs.com|international|tazobactam}} | DailyMedID = Tazobactam | pregnancy_category = B | licence_EU = yes | legal_status = Rx-only | routes_of_administration = Intravenous
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 89786-04-9 | ATC_prefix = J01 | ATC_suffix = CG02 | ATC_supplemental = | PubChem = 123630 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = DB01606 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 9421 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 110216 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = SE10G96M8W | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D00660 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 404
<!--Chemical data--> | C=10 | H=12 | N=4 | O=5 | S=1 | smiles = O=S2(=O)[C@]([C@@H](N1C(=O)C[C@H]12)C(=O)O)(Cn3nncc3)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C10H12N4O5S/c1-10(5-13-3-2-11-12-13)8(9(16)17)14-6(15)4-7(14)20(10,18)19/h2-3,7-8H,4-5H2,1H3,(H,16,17)/t7-,8+,10+/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = LPQZKKCYTLCDGQ-WEDXCCLWSA-N }}
'''Tazobactam''' is a pharmaceutical drug that inhibits the action of bacterial β-lactamases, especially those belonging to the SHV-1 and TEM groups. It is commonly used as its sodium salt, tazobactam sodium.
Tazobactam is combined with the extended spectrum β-lactam antibiotic piperacillin in the drug piperacillin/tazobactam, used in infections due to ''Pseudomonas aeruginosa''. Tazobactam broadens the spectrum of piperacillin by making it effective against organisms that express β-lactamase and would normally degrade piperacillin.<ref>{{cite journal | vauthors = Yang Y, Rasmussen BA, Shlaes DM | title = Class A beta-lactamases--enzyme-inhibitor interactions and resistance | journal = Pharmacology & Therapeutics | volume = 83 | issue = 2 | pages = 141–151 | date = August 1999 | pmid = 10511459 | doi = 10.1016/S0163-7258(99)00027-3 }}</ref>
Tazobactam was patented in 1982 and came into medical use in 1992.<ref>{{cite book| vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery|date=2006|publisher=John Wiley & Sons|isbn=9783527607495|page=490|url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA490 |language=en}}</ref>
== See also == * Ceftolozane * Sulbactam * Clavulanate
== References == {{reflist}}
{{PenicillinAntiBiotics}}
Category:Antibiotics Category:Beta-lactam antibiotics Category:Beta-lactamase inhibitors Category:Sulfones Category:Triazoles
{{antibiotic-stub}}