{{Chembox | Name = Stipitatic acid | ImageFile = Stipitatic acid.svg | ImageSize = 150px | ImageName = Chemical structure of stipitatic acid | ImageAlt = Chemical structure of stipitatic acid | PIN = 3,6-Dihydroxy-5-oxocyclohepta-1,3,6-triene-1-carboxylic acid | OtherNames = |Section1={{Chembox Identifiers | CASNo = 4440-39-5 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 35DNB4NP54 | Beilstein = 2723909 | ChEBI = 15957 | ChemSpiderID = 19955692 | KEGG = C01853 | PubChem = 20501 | SMILES = C1=C(C=C(C(=CC1=O)O)O)C(=O)O | StdInChI = 1S/C8H6O5/c9-5-1-4(8(12)13)2-6(10)7(11)3-5/h1-3,10-11H,(H,12,13) }} |Section2={{Chembox Properties | C=8 | H=6 | O=5 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Stipitatic acid''' is a tropolone derivative isolated from ''Talaromyces stipitatus'' (''Penicillium stipitatum'').<ref>{{cite journal |last1=Davison |first1=J. |last2=al Fahad |first2=A. |last3=Cai |first3=M. |last4=Song |first4=Z. |last5=Yehia |first5=S. Y. |last6=Lazarus |first6=C. M. |last7=Bailey |first7=A. M. |last8=Simpson |first8=T. J. |last9=Cox |first9=R. J. |title=Genetic, molecular, and biochemical basis of fungal tropolone biosynthesis |journal=Proceedings of the National Academy of Sciences |date=15 May 2012 |volume=109 |issue=20 |pages=7642–7647 |doi=10.1073/pnas.1201469109|doi-access=free |pmid=22508998 |pmc=3356636 }}</ref>
==References== {{reflist}}
Category:Tropolones Category:Tropones Category:Aromatic compounds
{{aromatic-stub}}