{{Short description|Chemical compound}} {{Drugbox | verifiedrevid = 443306099 | IUPAC_name = 8-[3-(4-Fluorophenoxy)propyl]-1-phenyl-1,3,8-triazaspiro[4,5]decan-4-one | image = Spiramide.svg | image_class = skin-invert-image | width = 250px
<!--Clinical data--> | tradename = | routes_of_administration =
<!--Pharmacokinetic data--> | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number = 510-74-7 | ATC_prefix = none | PubChem = 68186 | IUPHAR_ligand = 175 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ChemSpiderID = 61493 | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 64207 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 471LF4O004
<!--Chemical data--> | C=22 | H=27 | F=1 | N=3 | O=2 | smiles = c2cc(F)ccc2OCCCN3CCC1(CC3)N(CNC1=O)c4ccccc4 | StdInChI = 1S/C22H26FN3O2/c23-18-7-9-20(10-8-18)28-16-4-13-25-14-11-22(12-15-25)21(27)24-17-26(22)19-5-2-1-3-6-19/h1-3,5-10H,4,11-17H2,(H,24,27) | StdInChIKey = FJUKDAZEABGEIH-UHFFFAOYSA-N }}
'''Spiramide''' (developmental code name '''AMI-193''') is an experimental antipsychotic that acts as a selective 5-HT<sub>2A</sub>, 5-HT<sub>1A</sub>, and D<sub>2</sub> receptor antagonist. It has negligible affinity for the 5-HT<sub>2C</sub> receptor.<ref name="pmid11124389">{{cite journal |vauthors=Czoty PW, Howell LL |title=Behavioral effects of AMI-193, a 5-HT(2A)- and dopamine D(2)-receptor antagonist, in the squirrel monkey |journal=Pharmacology Biochemistry and Behavior |volume=67 |issue=2 |pages=257–64 |date=October 2000 |pmid=11124389 |doi= 10.1016/S0091-3057(00)00321-X|s2cid=36132685 }}</ref><ref name="pmid15610924">{{cite journal |vauthors=Luparini MR, Garrone B, Pazzagli M, Pinza M, Pepeu G |title=A cortical GABA-5HT interaction in the mechanism of action of the antidepressant trazodone |journal=Progress in Neuro-psychopharmacology & Biological Psychiatry |volume=28 |issue=7 |pages=1117–27 |date=November 2004 |pmid=15610924 |doi=10.1016/j.pnpbp.2004.05.046 |s2cid=24076522 |url=https://zenodo.org/record/853060}}</ref><ref name="pmid17965538">{{cite journal |vauthors=Hamada K, Yoshida M, Isayama H, Yagi Y, Kanazashi S, Kashihara Y, Takeuchi K, Yamaguchi I |title=Possible involvement of endogenous 5-HT in aggravation of cerulein-induced acute pancreatitis in mice |journal=Journal of Pharmacological Sciences |volume=105 |issue=3 |pages=240–50 |date=November 2007 |pmid=17965538 |doi= 10.1254/jphs.FP0071049|doi-access=free }}</ref> ==See also== *Spirodecanone == References == {{Reflist|2}}
{{Navboxes | title = Pharmacodynamics | titlestyle = background:#ccccff | list1 = {{Dopamine receptor modulators}} {{Serotonin receptor modulators}} {{Xenobiotic-sensing receptor modulators}} }}
Category:Butyrophenone antipsychotics Category:4-Fluorophenyl compounds Category:Lactams Category:Nitrogen heterocycles Category:Phenol ethers Category:Spiro compounds Category:Heterocyclic compounds with 2 rings
{{nervous-system-drug-stub}}