{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477858890 | ImageFile = Solasodine.svg | IUPACName = (22''R'',25''R'')-Spirosol-5α-en-3β-ol | SystematicName = (2''S'',2′''R'',4a''R'',4b''S'',5′''R'',6a''S'',6b''R'',7''S'',9a''S'',10a''S'',10b''S'')-4a,5′,6a,7-Tetramethyl-1,2,3,4,4a,4b,5,6,6a,6b,7,9a,10,10a,10b,11-hexadecahydrospiro[naptho[2′,1′:4,5]indeno[2,1-''b'']furan-8,2′-piperidin]-2-ol | OtherNames = Purapuridine; Solancarpidine; Solanearpidine; Solanidine-S |Section1={{Chembox Identifiers | Abbreviations = | CASNo = 126-17-0 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = L40Y453Y96 | EINECS = 204-774-2 | PubChem = 442985 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 391288 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 514596 | SMILES = O[C@@H]6C/C5=C/C[C@@H]1[C@H](CC[C@]3([C@H]1C[C@@H]4O[C@@]2(NC[C@H](C)CC2)[C@H]([C@H]34)C)C)[C@@]5(C)CC6 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI=1S/C27H43NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28-29H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = KWVISVAMQJWJSZ-VKROHFNGSA-N | RTECS = | MeSHName = | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 9190 | KEGG_Ref = {{keggcite|changed|kegg}} | KEGG = C10822 }} |Section2={{Chembox Properties | C=27 | H=43 | N=1 | O=2 | Appearance = | Density = | MeltingPt = | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | Solubility = | SolubleOther = | Solvent = | pKa = | pKb = }} |Section7={{Chembox Hazards | ExternalSDS = | MainHazards = | NFPA-H = | NFPA-F = | NFPA-R = | NFPA-S = | HPhrases = | PPhrases = | GHS_ref = | FlashPt = | AutoignitionPt = | ExploLimits = | PEL = }} }}

'''Solasodine''' is a poisonous alkaloid chemical compound that occurs in plants of the family Solanaceae such as potatoes and tomatoes.<ref name=Everist>{{cite book |last=Everist |first=S.L. |title=Poisonous Plants of Australia |publisher=Angus & Robertson |year=1981 |isbn=978-0-207-14228-4}}</ref> Solasonine and solamargine are glycoalkaloid derivatives of solasodine.<ref name=Everist/> Solasodine is teratogenic to hamster fetuses in a dose of 1200 to 1600&nbsp;mg/kg.<ref>{{cite book |last=Kinghorn |first=A.D. |chapter=Toxins and Teratogens of the Solanaceae and Liliaceae |title=Toxic plants |publisher=Society for Economic Botany, Columbia University Press |year=2010 |pages=75–76 |isbn=978-0231515689 |chapter-url=https://books.google.com/books?id=CZPDzu2dGDEC&pg=PA75}}</ref> A 2013 literature survey found that various studies have indicated that solasodine may have diuretic, anticancer, antifungal, cardiotonic, antispermatogenetic, antiandrogenic, immunomodulatory, antipyretic and/or various other effects on central nervous system.<ref>{{cite journal |title=Medicinal significance, pharmacological activities, and analytical aspects of solasodine: A concise report of current scientific literature |first=Kanika |last=Patel |first2=Ravi B.|last2=Singh |first3=Dinesh K.|last3=Patel |journal=Journal of Acute Disease |volume=2 |issue=2 |year=2013 |pages=92–98 |doi=10.1016/S2221-6189(13)60106-7 |doi-access=free }}</ref>

== Uses == It is commercially used as a precursor for the production of complex steroidal compounds such as contraceptive pills, via a 16-DPA intermediate.<ref name=Everist/>

== See also == * ''Solanum mauritianum''

== References == {{reflist}}

Category:Steroidal alkaloids Category:Plant toxins Category:Steroidal alkaloids found in Solanaceae Category:Spiro compounds