{{distinguish|text=the reducing agent Sodium dithionite, or the sterilizing agent Sodium metabisulfite}} {{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 464401133 | Name = Sodium dithionate | ImageFile = Sodium-dithionate-2D.png | ImageSize = 200px | ImageName = Two sodium cations and one dithionate anion | ImageFile1 = Sodium-dithionate-3D-balls-ionic.png | ImageName1 = Ball-and-stick model of the component ions | IUPACName = Sodium dithionate | OtherNames = Sodium hyposulfate, Sodium metabisulfate |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 128833 | InChI = 1/2Na.H2O6S2/c;;1-7(2,3)8(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2 | InChIKey = CSMWJXBSXGUPGY-NUQVWONBAI | SMILES = [Na+].[Na+].[O-]S(=O)(=O)S([O-])(=O)=O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/2Na.H2O6S2/c;;1-7(2,3)8(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = CSMWJXBSXGUPGY-UHFFFAOYSA-L | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 7631-94-9 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = RPF7Z41GAW | PubChem = 146045 | EINECS = 231-550-1 }} |Section2={{Chembox Properties | Formula = Na<sub>2</sub>S<sub>2</sub>O<sub>6</sub> | MolarMass = 206.106 g/mol | Appearance = White crystalline powder | Density = 2.19 g/cm<sup>3</sup> | Solubility = 6.27 g/100 mL (0 °C) <br> 15.12 g/100 mL (20 °C) <br> 64.74 g/100 mL (100 °C) | MeltingPtC = 190 | MeltingPt_notes = (decomposes) <br> 52 °C (dihydrate) | BoilingPtC = 267 | BoilingPt_notes = decomposes }} |Section3={{Chembox Structure | MolShape = | Coordination = | CrystalStruct = | Dipole = }} |Section7={{Chembox Hazards | ExternalSDS = | MainHazards = | NFPA-H = 3 | NFPA-F = 0 | NFPA-R = 0 }} }}
'''Sodium dithionate''' Na<sub>2</sub>S<sub>2</sub>O<sub>6</sub> is an important compound for inorganic chemistry. It is also known under names '''disodium dithionate''', '''sodium hyposulfate''', and '''sodium metabisulfate'''. The sulfur can be considered to be in its +5 oxidation state.
It should not be confused with sodium dithionite, Na<sub>2</sub>S<sub>2</sub>O<sub>4</sub>, which is a very different compound, and is a powerful reducing agent with many uses in chemistry and biochemistry. Confusion between dithionate and dithionite is commonly encountered, even in manufacturers' catalogues.
==Preparation== Sodium dithionate is produced by the oxidation of sodium bisulfite by manganese dioxide:<ref name="palmer1954">{{cite book | title = Experimental Inorganic Chemistry | author = W. G. Palmer | publisher = CUP Archive | year = 1954 | isbn = 0-521-05902-X | pages = 361–365 }}</ref>
:2 NaHSO<sub>3</sub> + MnO<sub>2</sub> → Na<sub>2</sub>S<sub>2</sub>O<sub>6</sub> + MnO + H<sub>2</sub>O
Alternatively, it can be prepared by the oxidation of sodium sulfite by the silver(I) cation:<ref name="palmer1954" />
:{{chem|Na|2|SO|3}} + 2 Ag{{su|p=+}} + SO{{su|b=3|p=2−}} → {{chem|Na|2|S|2|O|6}} + 2 Ag
Another method is via oxidation of sodium thiosulfate with chlorine:{{Citation needed|date=June 2009}}
:3 Cl<sub>2</sub> + Na<sub>2</sub>S<sub>2</sub>O<sub>3</sub>·5H<sub>2</sub>O + 6 NaOH → Na<sub>2</sub>S<sub>2</sub>O<sub>6</sub> + 6 NaCl + 8 H<sub>2</sub>O
And another method to produce sodium dithionate is treating sodium thiosulfate with sodium hypochlorite solution.
==Structure==
The dithionate ion represents sulfur that is oxidized relative to elemental sulfur, but not totally oxidized. Sulfur can be reduced to sulfide or totally oxidized to sulfate, with numerous intermediate oxidation states in inorganic moieties, as well as organosulfur compounds. Example inorganic ions include sulfite and thiosulfate.
Sodium dithionate crystallize as orthorhombic crystals of the dihydrate ({{chem|Na|2|S|2|O|6}}). The water of crystallization is lost when heated to 90 °C, and the structure becomes hexagonal.<ref>{{cite journal | journal = Canadian Journal of Chemistry | publisher = The National Research Council of Canada | volume = 41 | issue = 2 | date=February 1963 | title = X-Ray Diffraction Data for Alkali Dithionates | author1 = D. W. Larson | author2 = A. B. VanCleave | pages = 219–223 | doi=10.1139/v63-035 | doi-access = free }}</ref>
Large single crystals of ({{chem|Na|2|S|2|O|6|·2H|2|O}}) have been grown and studied for pulsed lasing purposes (pico second spectroscopy) with great success by E. Haussühl and cols.<ref>{{cite journal|last=Haussühl|first=E.|author2=A. A. Kaminskii |journal=Laser Physics|year=2010|volume=15|issue=5|pages=714–727}}</ref>
==Properties==
Sodium dithionate is a very stable compound which is not oxidized by permanganate, dichromate or bromine. It can be oxidized to sulfate under strongly oxidizing conditions: these include boiling for one hour with 5 M sulfuric acid with an excess of potassium dichromate, or treating with an excess of hydrogen peroxide then boiling with concentrated hydrochloric acid.
The Gibbs free energy change for (for example) the dithionate anion's oxidation to sulfate is a negative −300 kJ/mol, making it thermodynamically unstable against oxidation, but the kinetics for this reaction are rather poor. For similar reasons, the dithionate anion has been used to form single crystals of large cation complexes in high oxidation states, as the resulting salts are very likely highly kinetically stable(unless in extraordinary conditions that obviously do not belong to crystal analysis- see above), enough to survive all the way throughout the analysis of the crystal.
==References== {{Refimprove|date=June 2009}} {{reflist}}
{{Sodium compounds}}
Category:Dithionates Category:Sodium compounds