{{Short description|Chemical compound}} {{cs1 config|name-list-style=vanc}} {{Drugbox | Watchedfields = changed | verifiedrevid = 386068889 | IUPAC_name = (2Z)-2-[(2S,3R,4S,6R)-2-hydroxy-3,4-dimethoxy-6-[(2R,3R,4S,5S,6R)-3,4, | image = Simmondsin.svg | image_class = skin-invert-image | width = 300
<!--Clinical data--> | tradename = | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number = 51771-52-9 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = O51H15R39K | ATC_prefix = none | PubChem = 6437384 | ChemSpiderID = 4941947
<!--Chemical data--> | C=16 | H=25 | N=1 | O=9 | smiles = N#C\C=C2/[C@H](O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)C[C@H](OC)[C@H](OC)[C@H]2O | StdInChI = 1S/C16H25NO9/c1-23-9-5-8(7(3-4-17)11(19)15(9)24-2)25-16-14(22)13(21)12(20)10(6-18)26-16/h3,8-16,18-22H,5-6H2,1-2H3/b7-3+/t8-,9+,10-,11+,12-,13+,14-,15+,16-/m1/s1 | StdInChIKey = KURSRHBVYUACKS-XGYNEUJOSA-N }}
'''Simmondsin''' is a component of jojoba seeds (pronounced "ho-HO-bah") (''Simmondsia chinensis''). While it had been considered toxic due to jojoba seed meal causing weight loss in animals, in recent years its appetite suppressant effect has also been researched as a potential treatment for obesity.<ref>{{cite web | publisher = United States Department of Agriculture, Agricultural Research Service. | url = https://agresearchmag.ars.usda.gov/2000/dec/jojoba | title = Simmondsin From Jojoba - Checked for Appetite Suppression }}</ref> It is thought to reduce appetite by increasing levels of cholecystokinin.<ref>{{cite journal | vauthors = Cokelaere MM, Busselen P, Flo G, Daenens P, Decuypere E, Kühn E, Van Boven M | title = Devazepide reverses the anorexic effect of simmondsin in the rat | journal = The Journal of Endocrinology | volume = 147 | issue = 3 | pages = 473–7 | date = December 1995 | pmid = 8543917 | doi = 10.1677/joe.0.1470473 }}</ref><ref>{{cite journal | vauthors = Flo G, Vermaut S, Van Boven M, Daenens P, Buyse J, Decuypere E, Kühn E, Cokelaere M | display-authors = 6 | title = Comparison of the effects of simmondsin and cholecystokinin on metabolism, brown adipose tissue and the pancreas in food-restricted rats | journal = Hormone and Metabolic Research | volume = 30 | issue = 8 | pages = 504–8 | date = August 1998 | pmid = 9761380 | doi = 10.1055/s-2007-978921 | s2cid = 260166054 }}</ref><ref>{{cite journal | vauthors = Flo G, Van Boven M, Vermaut S, Daenens P, Decuypere E, Cokelaere M | title = The vagus nerve is involved in the anorexigenic effect of simmondsin in the rat | journal = Appetite | volume = 34 | issue = 2 | pages = 147–51 | date = April 2000 | pmid = 10744903 | doi = 10.1006/appe.1999.0299 | s2cid = 42949049 }}</ref><ref>{{cite journal | vauthors = Boozer CN, Herron AJ | title = Simmondsin for weight loss in rats | journal = International Journal of Obesity | volume = 30 | issue = 7 | pages = 1143–8 | date = July 2006 | pmid = 16462820 | doi = 10.1038/sj.ijo.0803251 | doi-access = | s2cid = 1282460 }}</ref>
== References == {{Reflist}}
{{Antiobesity preparations}}
Category:Anorectics Category:Cyanogenic glycosides Category:Plant toxins
{{gastrointestinal-drug-stub}}