{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = 1-[2-[1-(4-chlorophenyl)-1-phenyl-ethoxy]ethyl]azepane | image = Setastine.png | image_class = skin-invert-image | image2 = Setastine-3D-balls.png | image_class2 = bg-transparent

<!--Clinical data--> | tradename = | pregnancy_category = | legal_status = | routes_of_administration =

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers-->

| index2_label = HCl | CAS_number2_Ref = {{cascite|correct|CAS}} | CAS_number2 = 59767-13-4 | UNII2_Ref = {{fdacite|correct|FDA}} | UNII2 = T2MB6P84ON

| CAS_number = 64294-95-7 | ATC_prefix = | ATC_suffix = | PubChem = 43082 | ChemSpiderID = 39258 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 6G3OCF528J

<!--Chemical data--> | C=22 | H=28 | Cl=1 | N=1 | O=1 | smiles = CC(C1=CC=CC=C1)(C2=CC=C(C=C2)Cl)OCCN3CCCCCC3 }}

'''Setastine''' ('''Loderix''') is an antihistamine used to treat allergies and rhinitis.<ref name="pmid1677500">{{cite journal | vauthors = Lantos A, Tóth A, Zsiray M | title = Loderix (setastine) tablets in the treatment of allergic rhinoconjunctivitis | journal = Therapia Hungarica | volume = 39 | issue = 1 | pages = 22–24 | year = 1991 | pmid = 1677500 }}</ref><ref name="pmid2576575">{{cite journal | vauthors = Hirschberg A, Ribári O, Krasznai M | title = Results obtained with Loderix tablet in chronic rhinitis patients | journal = Therapia Hungarica | volume = 37 | issue = 4 | pages = 202–204 | year = 1989 | pmid = 2576575 }}</ref>

== Pharmacology ==

=== Pharmacodynamics ===

Setastine acts as a highly selective H<sub>1</sub> receptor antagonist.<ref name="pmid1982751">{{cite journal | vauthors = Porszász J, Varga F, Porszász KG, Szolscányi J, Barthó L, Petöcz L, Kápolnai L | title = Pharmacology of the new H1-receptor antagonist setastine hydrochloride | journal = Arzneimittel-Forschung | volume = 40 | issue = 12 | pages = 1340–1345 | date = December 1990 | pmid = 1982751 }}</ref> It has no anticholinergic, antiadrenergic, or antiserotonergic effects.

=== Pharmacokinetics ===

Setastine penetrates the blood-brain-barrier poorly so it is only mildly sedating compared to related molecules like diphenhydramine.<ref name="pmid1982751"/>

== See also == * Clemastine

== References == {{Reflist|2}}

{{Nasal preparations}} {{Histaminergics}}

Category:H1 receptor antagonists Category:4-Chlorophenyl compounds Category:Ethers Category:Azepanes Category:Peripherally selective drugs Category:Ethanolamines