{{chembox |ImageFile=Salutaridine.svg | ImageClass = skin-invert-image |ImageSize=200 |ImageFile2=Salutaridine 3D BS.png | ImageClass2 = bg-transparent |ImageSize2=200 |IUPACName=4-Hydroxy-3,6-dimethoxy-17-methyl-5,6,8,14-tetradehydromorphinan-7-one |SystematicName=(4a''S'',10''R'')-5-Hydroxy-3,6-dimethoxy-11-methyl-9,10-dihydro-2''H''-10,4a-(azanoethano)phenanthren-2-one |OtherNames= |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo=1936-18-1 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 7X10PRH74D | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = C05179 | PubChem=5408233 | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 17225 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 404097 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 16736005 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C19H21NO4/c1-20-7-6-19-10-16(24-3)14(21)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19/h4-5,9-10,13,22H,6-8H2,1-3H3/t13-,19+/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = GVTRUVGBZQJVTF-YJYMSZOUSA-N | SMILES=CN1CC[C@]23C=C(C(=O)C=C2[C@H]1CC4=C3C(=C(C=C4)OC)O)OC }} |Section2={{Chembox Properties | C=19 | H=21 | N=1 | O=4 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} }}

'''Salutaridine''', also known as '''floripavine''', is an alkaloid that is present in the morphinan alkaloid pathway of opium poppy, ''Papaver somniferum''.

==Biosynthesis== It is produced by the enzyme salutaridine synthase that catalyzes the chemical reaction from its precursor (''R'')-reticuline:<ref>{{KEGG enzyme|1.14.19.67}}</ref><ref>{{cite journal | vauthors = Gerady R, Zenk MH | date = 1993 | title = Formation of salutaridine from (R)-reticuline by a membrane-bound cytochrome P-450 enzyme from Papaver somniferum | journal = Phytochemistry | volume = 32 | pages = 79–86 | doi = 10.1016/0031-9422(92)80111-Q }}</ref>

{{chemrxn|width=55%| {{chemrxn/cpd|qid=Q82096614|caption=(''R'')-reticuline|upright=1.2 }} {{chemrxn/txt|+ NADPH }} {{chemrxn/arw||fwd_in={{chem2|O2}}|fwd_out={{chem2|2 H2O}} }} {{chemrxn/cpd|salutaridine }} {{chemrxn/txt|+ NADP<sup>+</sup>}} }}

The enzyme uses reduced nicotinamide adenine dinucleotide phosphate (NADPH) as its cofactor.

Salutaridine is converted to salutaridinol by the enzyme salutaridine reductase (NADPH).<ref>{{cite journal | vauthors = Gerady R, Zenk MH | date = 1993 | title = Purification and characterization of salutaridine:NADPH 7-oxidoreductase from ''Papaver somniferum'' | journal = Phytochemistry | volume = 34 | issue = 1 | pages = 125&ndash;132 | doi = 10.1016/S0031-9422(00)90793-3 | bibcode = 1993PChem..34..125G }}</ref>

{{chemrxn|width=50%| {{chemrxn/cpd|salutaridine }} {{chemrxn/txt|+ NADPH }} {{chemrxn/arw|fwd_out={{chem2|H+}} }} {{chemrxn/cpd|salutaridinol }} {{chemrxn/txt|+ NADP<sup>+</sup>}} }}

== References == {{Reflist}}

Category:Morphinans Category:Hydroxyarenes Category:Enones Category:Phenol ethers

{{alkaloid-stub}}