{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 447321268 | Name = Rumenic acid | ImageFile = Rumenic acid.svg | ImageSize = 200px | ImageName = Rumenic acid | PIN = (9''Z'',11''E'')-Octadeca-9,11-dienoic acid | OtherNames = Bovinic acid; C9-T11 acid | Section1 = {{Chembox Identifiers | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 2540-56-9 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 46JZW3MR59 | SMILES = CCCCCC\C=C/C=C/CCCCCCCC(=O)O | PubChem = 5280644 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 4444245 | InChI = 1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9- | InChIKey = JBYXPOFIGCOSSB-GOJKSUSPBK | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9- | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = JBYXPOFIGCOSSB-GOJKSUSPSA-N | RTECS = | MeSHName = | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 32798 | KEGG_Ref = {{keggcite|changed|kegg}} | KEGG = C04056 }} | Section2 = {{Chembox Properties | C=18|H=32|O=2 | Density = | MeltingPt = | BoilingPt = }} }}
'''Rumenic acid''', also known as '''bovinic acid''', is a conjugated linoleic acid (CLA) found in the fat of ruminants and in dairy products. It is an omega-7 trans fatty acid. Its lipid shorthand name is cis-9, trans-11 18:2 acid. The name was proposed by Kramer ''et al.'' in 1998.<ref name=Kramer>{{cite journal |vauthors=Kramer J, Parodi P, Jensen R, Mossoba M, Yurawecz M, Adlof R |title=Rumenic acid: a proposed common name for the major conjugated linoleic acid isomer found in natural products |journal=Lipids |volume=33 |issue=8 |page=835 |year=1998 |pmid=9727617 |doi=10.1007/s11745-998-0279-6|s2cid=10693714 }}</ref> It can be considered as the principal dietary form, accounting for as much as 85-90% of the total CLA content in dairy products.<ref name=Cyberlipid>{{cite web | url=http://www.cyberlipid.org/fa/acid0003.htm | title= Polyenoic Fatty Acids | author=Cyberlipid| accessdate=2007-01-17}}</ref>
==Biosynthesis and biotransformations== Rumenic acid is produced from vaccenic acid by the action of unsaturase enzymes.<ref>{{cite journal |doi=10.1093/ajcn/76.3.504|title=Bioconversion of vaccenic acid to conjugated linoleic acid in humans |year=2002 |last1=Turpeinen |first1=Anu M. |last2=Mutanen |first2=Marja |last3=Aro |first3=Antti |last4=Salminen |first4=Irma |last5=Basu |first5=Samar |last6=Palmquist |first6=Donald L. |last7=Griinari |first7=J Mikko |journal=The American Journal of Clinical Nutrition |volume=76 |issue=3 |pages=504–510 |pmid=12197992 |doi-access=free }}</ref> Rumenic acid is converted back to vaccenic acid en route to stearic acid.
==Further reading== {{cite journal |journal= Journal of Dairy Science|volume=88|issue=449|year=2005 |title=Letter to the Editor: Vaccenic and Rumenic Acids, A Distinct Feature of Ruminant Fats |author=F. Destaillats |author2=E. Buyukpamukcu |author3=P.-A. Golay |author4=F. Dionisi |author5=F. Giuffrida |name-list-style=amp |doi= 10.3168/jds.S0022-0302(05)72705-3 |page= 449 |pmid=15653508|doi-access=free }}
==References== {{Reflist}}
{{Fatty acids}}
{{DEFAULTSORT:Rumenic Acid}} Category:Fatty acids Category:Alkenoic acids