{{Chembox | ImageFile = Rotundone.svg | ImageSize = 150px | IUPACName = Guaia-1(5),11-dien-2-one | SystematicName = (3''S'',5''R'',8''S'')-3,8-Dimethyl-5-(prop-1-en-2-yl)-3,4,5,6,7,8-hexahydroazulen-1(2''H'')-one | OtherNames = |Section1={{Chembox Identifiers | CASNo = 18374-76-0 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = U33H52BQ0P | PubChem = 5321003 | ChemSpiderID = 4478902 | SMILES = O=C1\C2=C(/[C@H](C1)C)C[C@H](\C(=C)C)CC[C@@H]2C | InChI = 1/C15H22O/c1-9(2)12-6-5-10(3)15-13(8-12)11(4)7-14(15)16/h10-12H,1,5-8H2,2-4H3/t10-,11-,12+/m0/s1 | InChIKey = NUWMTBMCSQWPDG-SDDRHHMPBR | StdInChI = 1S/C15H22O/c1-9(2)12-6-5-10(3)15-13(8-12)11(4)7-14(15)16/h10-12H,1,5-8H2,2-4H3/t10-,11-,12+/m0/s1 | StdInChIKey = NUWMTBMCSQWPDG-SDDRHHMPSA-N }} |Section2={{Chembox Properties | C=15 | H=22 | O=1 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Rotundone''' is a sesquiterpene originally discovered in the tubers of Java grass (''Cyperus rotundus''). Rotundone is also present in the essential oils of black pepper, marjoram, oregano, rosemary, basil, thyme, and geranium, as well as in some Syrah wines.<ref>{{cite journal | doi = 10.1021/jf800184t | title = Determination of Rotundone, the Pepper Aroma Impact Compound, in Grapes and Wine | year = 2008 | last1 = Siebert | first1 = Tracey E. | last2 = Wood | first2 = Claudia | last3 = Elsey | first3 = Gordon M. | last4 = Pollnitz | first4 = Alan P. | journal = Journal of Agricultural and Food Chemistry | volume = 56 | issue = 10 | pages = 3745–8 | pmid = 18461962}}</ref><ref>{{cite web |title=Overlooked pepper compound spices up red wine |url=https://www.chemistryworld.com/news/overlooked-pepper-compound-spices-up-red-wine/3003098.article |publisher=Royal Society of Chemistry}}</ref> It imparts a peppery aroma.<ref>{{cite magazine | magazine = Chemical & Engineering News | url = http://pubs.acs.org/cen/news/86/i20/8620news5.html | title = Rotundone Imparts Peppery Aroma}}</ref>
==References== {{Reflist}}
Category:Terpenes and terpenoids