{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = 3α-hydroxy-5β-pregnane-11,20-dione | image = Renanolone.svg | image_class = skin-invert-image | CAS_number = 565-99-1 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = D8Z6E4IR2J | ATC_prefix = none | ATC_suffix = | PubChem = 68930 | DrugBank = | ChemSpiderID = 62156 | C=21 | H=32 | O=3 | smiles = CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC(=O)[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)C | StdInChI = 1S/C21H32O3/c1-12(22)16-6-7-17-15-5-4-13-10-14(23)8-9-20(13,2)19(15)18(24)11-21(16,17)3/h13-17,19,23H,4-11H2,1-3H3/t13-,14-,15+,16-,17+,19-,20+,21-/m1/s1 | StdInChIKey = DUHUCHOQIDJXAT-CSXWOMMHSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category= | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration = }}
'''Renanolone''' (INN; also known as '''11-ketopregnanolone''' or '''5β-pregnan-3α-ol-11,20-dione''') is a synthetic{{Citation needed|date=December 2016}} neuroactive steroid which is described as a general anesthetic, but was never introduced for clinical use.<ref name="HillMakin1991">{{cite book | vauthors = Hill RA, Makin HL, Kirk DN, Murphy GM | title = Dictionary of Steroids | url = https://books.google.com/books?id=qw5X0NK1A90C&pg=PA592 | date = 23 May 1991 | publisher = CRC Press | isbn = 978-0-412-27060-4 | page = 592}}</ref> Its isomers, alfaxolone and alfadolone, are also general anesthetics, and are known to act as positive allosteric modulators of the GABA<sub>A</sub> receptor, a property which is likely the case for renanolone as well.
==Chemistry== {{See also|List of neurosteroids}}
==See also== * Alfadolone * Alfaxolone * Ganaxolone * Hydroxydione * Minaxolone * Pregnanolone
==References== {{Reflist}}
{{General anesthetics}} {{GABAAR PAMs}}
Category:5β-Pregnanes Category:General anesthetics Category:Neurosteroids Category:Secondary alcohols Category:Diketones Category:GABAA receptor positive allosteric modulators
{{Pregnanes-stub}} {{Nervous-system-drug-stub}}