{{short description|Chemical compound}} {{Drugbox | verifiedrevid = 384102285 | IUPAC_name = N'-(4-imino-1,2-dimethyl-6-quinolyl)-1,6-dimethylpyrimidin-1-ium-2,4-diamine | image = quinapyramine.png | image_class = skin-invert-image

<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration =

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number = 20493-41-8 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = B2NT1100WR | ATCvet = yes | ATC_prefix = P51 | ATC_suffix = DX05 | PubChem = 5351805 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | ChemSpiderID = 4508792

<!--Chemical data--> | chemical_formula = | C=17 | H=21 | N=6 | charge = + | smiles = CC1=CC(=N)C2=C(N1C)C=CC(=C2)NC3=NC(=[N+](C(=C3)C)C)N | StdInChI=1S/C17H20N6/c1-10-7-14(18)13-9-12(5-6-15(13)22(10)3)20-16-8-11(2)23(4)17(19)21-16/h5-9,18H,1-4H3,(H2,19,20,21)/p+1/b18-14+ | StdInChIKey = KMJWBVJQFGRCEB-NBVRZTHBSA-O }}

'''Quinapyramine''' is a trypanocidal agent for veterinary use.<ref>{{cite journal | vauthors = Hawking F, Sen AB | title = The trypanocidal action of homidium, quinapyramine and suramin | journal = British Journal of Pharmacology and Chemotherapy | volume = 15 | issue = 4 | pages = 567–70 | date = December 1960 | pmid = 13712404 | pmc = 1482270 | doi = 10.1111/j.1476-5381.1960.tb00283.x }}</ref><ref>{{cite journal | vauthors = Ranjithkumar M, Saravanan BC, Yadav SC, Kumar R, Singh R, Dey S | s2cid = 16060891 | title = Neurological trypanosomiasis in quinapyramine sulfate-treated horses--a breach of the blood-brain barrier? | journal = Tropical Animal Health and Production | volume = 46 | issue = 2 | pages = 371–7 | date = February 2014 | pmid = 24197687 | doi = 10.1007/s11250-013-0498-9 }}</ref>

== References == {{reflist}}

Category:Antiparasitic agents Category:Quaternary ammonium compounds Category:Aminopyrimidines Category:Quinolines

{{antiinfective-drug-stub}}