Quinalphos

{{Chembox | ImageFile = Quinalphos.svg | ImageAlt = | PIN = ''O'',''O''-Diethyl ''O''-(quinoxalin-2-yl) phosphorothioate | OtherNames = ''O'',''O''-diethyl ''O''-quinoxalin-2-yl phosphorothioate; Diethquinalphion; Diethquinalphione |Section1={{Chembox Identifiers | CASNo = 13593-03-8 | CASNo_Ref = {{cascite|correct|}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 26S837727Y | PubChem = 26124 | ChemSpiderID = 24335 | SMILES = CCOP(=S)(OCC)OC1=NC2=CC=CC=C2N=C1 | InChI = 1/C12H15N2O3PS/c1-3-15-18(19,16-4-2)17-12-9-13-10-7-5-6-8-11(10)14-12/h5-9H,3-4H2,1-2H3 | InChIKey = JYQUHIFYBATCCY-UHFFFAOYAW | StdInChI = 1S/C12H15N2O3PS/c1-3-15-18(19,16-4-2)17-12-9-13-10-7-5-6-8-11(10)14-12/h5-9H,3-4H2,1-2H3 | StdInChIKey = JYQUHIFYBATCCY-UHFFFAOYSA-N | SMILES2 = S=P(OCC)(OCC)Oc1nc2ccccc2nc1 }} |Section2={{Chembox Properties | C=12|H=15|N=2|O=3|P=1|S=1 | Appearance = Reddish-brown liquid | Density = | MeltingPtC = 31 | BoilingPt = | Solubility = 17.8 mg/L at 22 °C }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Quinalphos''' is an organothiophosphate chemical chiefly used as a pesticide. It is a reddish-brown liquid. The chemical formula is C₁₂H₁₅N₂O₃PS, and IUPAC name ''O'',''O''-diethyl ''O''-quinoxalin-2-yl phosphorothioate.<ref>{{Cite web |url=http://cibrc.nic.in/list_sched.htm |title=Central Insecticides Board & Registration Committee. 'List of Insecticides'. |access-date=2012-01-12 |archive-date=2012-01-09 |archive-url=https://web.archive.org/web/20120109171440/http://cibrc.nic.in/list_sched.htm |url-status=dead }}</ref> Ranked 'moderately hazardous' in World Health Organization's (WHO) acute hazard ranking, use of quinalphos, classified as a yellow label (highly toxic) pesticide in India, is widely used in the following crops: wheat, rice, coffee, sugarcane, and cotton.

== References == {{Reflist}}

== External links == *{{PPDB|576}}

{{insecticides}}

Category:Organophosphate insecticides Category:Ethyl esters Category:Quinoxalines