{{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 448799106 | ImageFile = Quebecol.svg | ImageSize = 180px | ImageAlt = | IUPACName = 2,3,3-Tri-(3-methoxy-4-hydroxyphenyl)-1-propanol | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 1360605-46-4 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = XE6U6NUC3D | PubChem = 56838437 | ChEMBL = 2426727 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 29784847 | SMILES = COC1=C(C=CC(=C1)C(CO)C(C2=CC(=C(C=C2)O)OC)C3=CC(=C(C=C3)O)OC)O | InChI = 1/C24H26O7/c1-29-21-10-14(4-7-18(21)26)17(13-25)24(15-5-8-19(27)22(11-15)30-2)16-6-9-20(28)23(12-16)31-3/h4-12,17,24-28H,13H2,1-3H3 | InChIKey = YYZUHPNBYRRBOR-UHFFFAOYAE | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C24H26O7/c1-29-21-10-14(4-7-18(21)26)17(13-25)24(15-5-8-19(27)22(11-15)30-2)16-6-9-20(28)23(12-16)31-3/h4-12,17,24-28H,13H2,1-3H3 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = YYZUHPNBYRRBOR-UHFFFAOYSA-N}} |Section2={{Chembox Properties | C=24 | H=26 | O=7 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Quebecol''' is a polyphenolic chemical compound that has been isolated from maple syrup.<ref name=Li>{{cite journal | title = Quebecol, a novel phenolic compound isolated from Canadian maple syrup | doi = 10.1016/j.jff.2011.02.004 | year = 2011 | last1 = Li | first1 = Liya | last2 = Seeram | first2 = Navindra P. | journal = Journal of Functional Foods| volume = 3 | issue = 2 | pages = 125–128 }}</ref> It has the chemical formula C<sub>24</sub>H<sub>26</sub>O<sub>7</sub> and the systematic name 2,3,3-tri-(3-methoxy-4-hydroxyphenyl)-1-propanol. Analysis of maple sap before it is converted into syrup suggests that this compound is not naturally present in the sap but, instead, is formed during extraction or processing.<ref>{{cite news|url=http://www.burlingtonfreepress.com/article/20110404/NEWS02/110403015/Quebecol-fancy-name-healthful-compound-found-Canadian-syrup|archiveurl=https://archive.today/20120724024244/http://www.burlingtonfreepress.com/article/20110404/NEWS02/110403015/Quebecol-fancy-name-healthful-compound-found-Canadian-syrup|archivedate=24 July 2012|url-status=dead|title=Quebecol: A fancy name for healthful compound found in Canadian syrup|date=4 April 2011|first=Tim|last=Johnson|work=Burlington Free Press}}</ref> A total synthesis of the compound was reported in 2013.<ref>{{cite journal|last1=Cardinal|first1=Sébastien|last2=Voyer|first2=Normand|title=Total synthesis of quebecol|journal=Tetrahedron Letters|volume=54|issue=38|pages=5178–5180|doi=10.1016/j.tetlet.2013.07.048|year=2013}}</ref>

The chemical compound is named after the Canadian province of Quebec which is the world’s largest producer of maple syrup.

== References == {{reflist}}

Category:Polyphenols