{{Short description|Chemical compound}} {{cs1 config|name-list-style=vanc}} {{Drugbox | Verifiedfields = changed | verifiedrevid = 416526595 | IUPAC_name = (7a''R'')-7-methyl-6,7,7a,8-tetrahydro-5''H''-benzo[''g''][1,3]benzodioxolo[6,5,4-''de'']quinolin-12-ol | image = Pukateine Structure.svg | image_class = skin-invert-image

<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration =

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 81-67-4 | CAS_supplemental = | UNII_Ref = {{fdacite|correct|FDA}} | UNII = Z9Y5O2QUPA | ATC_prefix = none | ATC_suffix = | ATC_supplemental = | PubChem = 442340 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 258370 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 390793

<!--Chemical data--> | chemical_formula = | C=18 | H=17 | N=1 | O=3 | smiles = CN1CCC2=CC3=C(C4=C2[C@H]1CC5=C4C(=CC=C5)O)OCO3 | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C18H17NO3/c1-19-6-5-11-8-14-18(22-9-21-14)17-15(11)12(19)7-10-3-2-4-13(20)16(10)17/h2-4,8,12,20H,5-7,9H2,1H3/t12-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = IKMXUUHNYQWZBC-GFCCVEGCSA-N

| synonyms = <small>(''R'')-11-hydroxy-1,2-methylenedioxyaporphine</small> }}

'''Pukateine''' is an alkaloid found in the bark of the New Zealand tree ''Laurelia novae-zelandiae'' ("Pukatea"), as well as some South American plants.<ref name="pmid33153001">{{cite journal | vauthors = Quiroz-Carreño S, Pastene-Navarrete E, Espinoza-Pinochet C, Muñoz-Núñez E, Devotto-Moreno L, Céspedes-Acuña CL, Alarcón-Enos J | title = Assessment of Insecticidal Activity of Benzylisoquinoline Alkaloids from Chilean Rhamnaceae Plants against Fruit-Fly Drosophila melanogaster and the Lepidopteran Crop Pest Cydia pomonella | journal = Molecules | location = Basel, Switzerland | volume = 25 | issue = 21 | date = November 2020 | page = 5094 | pmid = 33153001 | pmc = 7663414 | doi = 10.3390/molecules25215094 | doi-access = free }}</ref> An extract from pukatea is used in traditional Māori herbal medicine as an analgesic.<ref>{{cite journal | vauthors = Dajas-Bailador FA, Asencio M, Bonilla C, Scorza MC, Echeverry C, Reyes-Parada M, Silveira R, Protais P, Russell G, Cassels BK, Dajas F | title = Dopaminergic pharmacology and antioxidant properties of pukateine, a natural product lead for the design of agents increasing dopamine neurotransmission | journal = General Pharmacology | volume = 32 | issue = 3 | pages = 373–9 | date = March 1999 | pmid = 10211594 | doi = 10.1016/s0306-3623(98)00210-9 }}</ref><ref>{{cite journal | vauthors = Valiente M, D'Ocon P, Noguera MA, Cassels BK, Lugnier C, Ivorra MD | title = Vascular activity of (-)-anonaine, (-)-roemerine and (-)-pukateine, three natural 6a(R)-1,2-methylenedioxyaporphines with different affinities for alpha1-adrenoceptor subtypes | journal = Planta Medica | volume = 70 | issue = 7 | pages = 603–9 | date = July 2004 | pmid = 15254852 | doi = 10.1055/s-2004-827181 | s2cid = 260249660 }}</ref>

Bernard Cracroft Aston studied the physical and chemical characteristics of the compound, and presented a paper with his findings to the Royal Society of New Zealand on 11 May 1909.<ref>{{cite journal |last=Aston |first=Bernard Cracroft |date=1909 |title=The Alkaloids of the Pukatea |url=http://rsnz.natlib.govt.nz/volume/rsnz_42/rsnz_42_02_007220.html |journal=Transactions of the Royal Society of New Zealand |volume=42 |access-date=October 20, 2015}}</ref>

== See also == {{cmn|colwidth=30em| *Apomorphine *Bulbocapnine *Glaucine *Nantenine *Nuciferine *Stepholidine *Tetrahydropalmatine }}

== References == {{Reflist|30em}}

{{Analgesics}} {{Dopaminergics}}

Category:Aporphine alkaloids Category:Analgesics Category:Hydroxyarenes Category:Dopamine agonists Category:Benzodioxoles

{{analgesic-stub}}