{{Distinguish|propylphenidine}} {{Short description|Stimulant drug}} {{Drugbox | IUPAC_name = Propyl 2-phenyl-2-(piperidin-2-yl)acetate | image = Propylphenidate-2D.svg | image_class = skin-invert-image | width = 220
<!--Clinical data--> | tradename = | routes_of_administration = | legal_CA = Schedule III | legal_DE = NpSG | legal_UK = Class B
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 1071564-47-0 <!--CAS number for undefined stereochemistry; for (R*,R*)- diastereomer CAS number is 99088-50-3 --> | ATC_suffix = | PubChem = 91844465 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 0Q064445GT | ChemSpiderID = 52085111
<!--Chemical data--> | C=16 | H=23 | N=1 | O=2 | smiles = C1(=CC=CC=C1)C(C(=O)OCCC)C2CCCCN2 | StdInChI = 1S/C16H23NO2/c1-2-12-19-16(18)15(13-8-4-3-5-9-13)14-10-6-7-11-17-14/h3-5,8-9,14-15,17H,2,6-7,10-12H2,1H3 | StdInChIKey = PRMWWEANNQSWAR-UHFFFAOYSA-N }}
'''Propylphenidate''' (also known as '''PPH''') is a piperidine based stimulant drug, closely related to methylphenidate, but with the methyl ester replaced by a propyl ester. It was banned in the UK as a Temporary Class Drug from April 2015 following its unapproved sale as a designer drug.<ref>[https://www.gov.uk/government/uploads/system/uploads/attachment_data/file/420983/TCDO_methylphenidate_NPS.pdf Methylphenidate-based NPS: A review of the evidence of use and harm. Advisory Council on the Misuse of Drugs, 31 March 2015]</ref>
== Legal status ==
Propylphenidate is illegal in Sweden as of 26 January 2016,<ref>{{cite web | url=http://www.folkhalsomyndigheten.se/nyheter-och-press/nyhetsarkiv/2015/november/31-nya-amnen-kan-klassas-som-narkotika-eller-halsofarlig-vara/ | title=31 nya ämnen kan klassas som narkotika eller hälsofarlig vara | publisher=Folkhälsomyndigheten | language=Swedish | date=November 2015}}</ref> and in Finland since 2017.<ref>{{Cite web |url=https://finlex.fi/fi/lainsaadanto/2014/1130 |title=Valtioneuvoston asetus kuluttajamarkkinoilta kielletyistä psykoaktiivisista aineista |access-date=2021-06-07 |archive-date=2023-05-01 |archive-url=https://web.archive.org/web/20230501232001/https://finlex.fi/fi/laki/ajantasa/2014/20141130#a12.11.2020-764 |url-status=live }}</ref>
== See also == * 3,4-Dichloromethylphenidate * 4-Fluoromethylphenidate * 4-Methylmethylphenidate * Dexmethylphenidate * Ethylphenidate * Isopropylphenidate * HDEP-28 * HDMP-28
== References == {{Reflist}}
{{Stimulants}} {{psychoactive-stub}} Category:Methylphenidate analogues Category:2-Benzylpiperidines Category:Norepinephrine–dopamine reuptake inhibitors Category:Stimulants Category:Designer drugs Category:2-Piperidinyl compounds Category:Propyl esters