{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = Propyl 1-(1-phenylethyl)-1''H''-imidazole-5-carboxylate | image = Propoxate.svg | image_class = skin-invert-image | CAS_number = 7036-58-0 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = M42D353K88 | ATC_prefix = None | ATC_suffix = | PubChem = 65591 | DrugBank = | ChemSpiderID = 59033 | chemical_formula = | C=15 | H=18 | N=2 | O=2 | SMILES = CCCOC(=O)c1cncn1C(C)c2ccccc2 | StdInChI = 1S/C15H18N2O2/c1-3-9-19-15(18)14-10-16-11-17(14)12(2)13-7-5-4-6-8-13/h4-8,10-12H,3,9H2,1-2H3 | StdInChIKey = LKGPZAQFNYKISK-UHFFFAOYSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration = }}
'''Propoxate''' (INN; '''R7464''') is an unmarketed anesthetic related to etomidate and metomidate. Although not employed in the treatment of humans, it has been used as an anesthetic in fish.<ref name="RossRoss2009">{{cite book|vauthors=Ross LG, Ross B|title=Anaesthetic and Sedative Techniques for Aquatic Animals|url=https://books.google.com/books?id=ghusg7fwLVsC&pg=PA111|date=22 January 2009|publisher=John Wiley & Sons|isbn=978-1-4443-0227-1|pages=111–}}</ref><ref name="HoarRandall1972">{{cite book|vauthors=Hoar WS, Randall DJ|title=FISH PHYSIOLOGY|url=https://books.google.com/books?id=MTXiVzg44sEC&pg=PA517|date=28 April 1972|publisher=Academic Press|isbn=978-0-08-058526-0|pages=517–}}</ref>
==References== {{Reflist}}
{{Anesthetics}} {{GABAAR PAMs}}
Category:Propyl esters Category:GABAA receptor positive allosteric modulators Category:General anesthetics Category:Imidazolecarboxylate esters Category:Janssen Pharmaceutica
{{nervous-system-drug-stub}}