{{short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 444481044 | IUPAC_name = [(3''S'',8''R'',9''S'',10''R'',13''S'',14''S'',17''S'')-17-ethyl-17-hydroxy-13-methyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-3-yl]propanoate | image = Propetandrol.png | image_class = skin-invert-image | width = 250px
<!--Clinical data--> | tradename = Solevar | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = By mouth | class = Androgen; Anabolic steroid; Androgen ester; Progestogen
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!-- Identifiers --> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 3638-82-2 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 20055548 | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 16737110 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = K0H1J6311W | KEGG = | ChEBI = | ChEMBL = 2105236 | synonyms = Propethandrol; SC-7294; 3β-(Propionyloxy)-17α-ethylestr-4-en-17β-ol; 17α-Ethylestr-4-en-3β,17β-diol 3β-propionate; 17α-Ethyl-19-nortestosterone 3β-propionate; 19-Nor-17α-pregn-4-ene-3β,17β-diol 3β-propionate; Norethandrolone 3β-propionate
<!--Chemical data--> | C=23 | H=36 | O=3 | SMILES = CCC(=O)O[C@H]1CC[C@@H]2[C@H]3CC[C@]4([C@H]([C@@H]3CCC2=C1)CC[C@]4(CC)O)C | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C23H36O3/c1-4-21(24)26-16-7-9-17-15(14-16)6-8-19-18(17)10-12-22(3)20(19)11-13-23(22,25)5-2/h14,16-20,25H,4-13H2,1-3H3/t16-,17-,18+,19+,20-,22-,23-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = ODOMHABFTBNARE-JSDYAUHVSA-N }}
'''Propetandrol''' ({{abbrlink|INN|International Nonproprietary Name}}) (brand name '''Solevar'''; former developmental code name '''SC-7294'''), or '''propethandrol''', also known as '''17α-ethyl-19-nortestosterone 3β-propionate''' or '''17α-ethyl-19-nor-4-androstenediol 3β-propionate''', as well as '''17α-ethylestr-4-en-3β,17β-diol 3β-propionate''', is a synthetic and orally active anabolic–androgenic steroid (AAS) and progestogen and a 17α-alkylated derivative of 19-nortestosterone.<ref name="Elks2014">{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA1031|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=1031}}</ref><ref name="pmid13947091">{{cite journal | vauthors = GELLER J | title = Effect of 17-ethyl-19-nortestosterone 3-enol propionate (SC-7294) on the metabolism of adrenal cortical steroids | journal = J. Clin. Endocrinol. Metab. | volume = 22 | issue = 11| pages = 1116–21 | year = 1962 | pmid = 13947091 | doi = 10.1210/jcem-22-11-1116 }}</ref> It is an androgen ester – specifically, the 3β-propionate ester of norethandrolone (17α-ethyl-19-nortestosterone).<ref name="Elks2014" /><ref name="pmid13947091" />
==See also== * Bolandiol * Bolenol * Methandriol * Penmesterol
==References== {{Reflist|2}}
{{Androgens and antiandrogens}} {{Progestogens and antiprogestogens}} {{Androgen receptor modulators}} {{Progesterone receptor modulators}}
Category:Androgen esters Category:Androgens Category:Estranes Category:Hepatotoxins Category:Sex hormone esters and conjugates Category:Progestogens Category:Propionate esters
{{Androgen-stub}} {{Estrane-stub}} {{genito-urinary-drug-stub}}