{{chembox | ImageFile = Progoitrin.svg | ImageSize = | IUPACName = |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 585-95-5 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = S27T66W417 | PubChem = 5281139 | ChEBI = 79352 | KEGG = C08425 | SMILES = OC[C@H]1O[C@@H](SC(C[C@@H](O)C=C)=NOS(O)(=O)=O)[C@H](O)[C@@H](O)[C@@H]1O | StdInChI = 1S/C11H19NO10S2/c1-2-5(14)3-7(12-22-24(18,19)20)23-11-10(17)9(16)8(15)6(4-13)21-11/h2,5-6,8-11,13-17H,1,3-4H2,(H,18,19,20)/t5-,6+,8+,9-,10+,11-/m0/s1 | StdInChIKey = MYHSVHWQEVDFQT-ILPXZUKPSA-N | ChemSpiderID = 58145377

}} |Section2={{Chembox Properties | Formula = C<sub>11</sub>H<sub>19</sub>NO<sub>10</sub>S<sub>2</sub> | MolarMass = | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }}

'''Progoitrin''' is a biochemical from the glucosinolate family that is found in some food, which is inactive but after ingestion is converted to goitrin. Goitrin decreases the thyroid hormone production.

Progoitrin has been isolated in cabbage, brussels sprouts, kale, peanuts, mustard, rutabaga, kohlrabi, spinach, cauliflower, horseradish, and rapeseed oil.<ref>Comprehensive Pharmacy Review, Leon Shargel, 6th edition, p1191.</ref>

==References== {{reflist}}

==Bibliography== *{{cite journal|last=Greer|first=Monte A.|title=Isolation from Rutabaga Seed of Progoitrin, the Precursor of the Naturally Occurring Antithyroid Compound, Goitrin (L-5-Vinyl-2-Thioöxazolidine)<sup>1</sup>|journal=Journal of the American Chemical Society|date=20 March 1956|volume=78|issue=6|pages=1260–1261|doi=10.1021/ja01587a052}}

Category:Glucosinolates {{Cruciferous Biochemistry}}