{{short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 448092475 | IUPAC_name = 1-Methyl-3-[3-methyl-4-[4-(trifluoromethylsulfonyl)phenoxy]phenyl]-1,3,5-triazinane-2,4,6-trione | image = Ponazuril.png | image_class = skin-invert-image
<!--Clinical data--> | tradename = Marquis | Drugs.com = {{drugs.com|pro|marquis}} | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = | legal_US = Rx-only | legal_status = Veterinary use only | routes_of_administration = Oral
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 69004-04-2 | ATCvet = yes | ATC_prefix = P51 | ATC_suffix = BC04 | ATC_supplemental = | PubChem = 3050408 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 2312474 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | UNII_Ref = {{fdacite|correct|FDA}} | UNII = JPW84AS66U | synonyms = ACD855; ACD-855
<!--Chemical data--> | C=18 | H=14 | F=3 | N=3 | O=6 | S=1 | SMILES = CC1=C(C=CC(=C1)N2C(=O)NC(=O)N(C2=O)C)OC3=CC=C(C=C3)S(=O)(=O)C(F)(F)F | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI=1S/C18H14F3N3O6S/c1-10-9-11(24-16(26)22-15(25)23(2)17(24)27)3-8-14(10)30-12-4-6-13(7-5-12)31(28,29)18(19,20)21/h3-9H,1-2H3,(H,22,25,26) | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = VBUNOIXRZNJNAD-UHFFFAOYSA-N }}
'''Ponazuril''' (INN), sold by Merial, Inc.,<ref>{{Cite web|url=http://merial.com/en/content-pages/press-releases/merial-acquires-two-major-equine-health-products-from-bayer|title=Merial Acquires LEGEND® and MARQUIS® | work = Boehringer Ingelheim |access-date=2018-04-30}}</ref> now part of Boehringer Ingelheim,<ref>{{Cite web|url=https://www.boehringer-ingelheim.com/press-release/sanofi-and-boehringer-ingelheim-confirm-closing-business-swap-january-1st-2017|title=Sanofi and Boehringer Ingelheim confirm Closing of business swap {{!}} www.boehringer-ingelheim.com|website=boehringer-ingelheim.com|language=en|access-date=2018-04-30}}</ref> under the trade name '''Marquis (15% w/w ponazuril)''', is a drug currently approved for the treatment of equine protozoal myeloencephalitis (EPM) in horses, caused by coccidia ''Sarcocystis neurona''.<ref>{{cite web | title = Marquis | url = https://www.drugs.com/pro/marquis.html | work = Drugs.com}}</ref><ref>{{cite journal | vauthors = Mackay RJ, Tanhauser ST, Gillis KD, Mayhew IG, Kennedy TJ | title = Effect of intermittent oral administration of ponazuril on experimental Sarcocystis neurona infection of horses | journal = American Journal of Veterinary Research | volume = 69 | issue = 3 | pages = 396–402 | date = March 2008 | pmid = 18312139 | doi = 10.2460/ajvr.69.3.396 | doi-access = free }}</ref> Veterinarians have been preparing a formulary version of the medication for use in small animals such as cats, dogs, and rabbits against coccidia as an intestinal parasite. Treatment for intestinal coccidia in small animals is far shorter than treatment for EPM. NOTE: Dogs suffering from seizures due to Toxoplasma gondii, Neospora caninum, Neospora hughesi, Sarcocystis neurona, or other obligate intracellular coccidian protozoal parasites known to cause brain and spinal column disease, can be effectively treated using Ponazuril for a minimum of 90 days. Ponazuril is coccidiocidal, meaning that if treatment is continuous for 90 days or more, seizures may cease in dogs and other companion animals. Testing for these neurological coccidial parasites should be done using IFAT technology (Indirect Immunofluorescence Antibody Titer testing), as other laboratory testing methods can and will result in notoriously false negative results.{{cn|date=December 2022}} Along with its analogue ACD856, ponazuril (also known as ACD855) is a positive allosteric modulator of the tropomyosin receptor kinases TrkA and TrkB.<ref name="DahlströmMadjidNordvall2021">{{cite journal | vauthors = Dahlström M, Madjid N, Nordvall G, Halldin MM, Vazquez-Juarez E, Lindskog M, Sandin J, Winblad B, Eriksdotter M, Forsell P | title = Identification of Novel Positive Allosteric Modulators of Neurotrophin Receptors for the Treatment of Cognitive Dysfunction | journal = Cells | volume = 10 | issue = 8 | date = July 2021 | page = 1871 | pmid = 34440640 | pmc = 8391421 | doi = 10.3390/cells10081871 | doi-access = free | url = }}</ref>
== See also == * Clazuril * Diclazuril * Toltrazuril
== References == {{Reflist}}
{{Growth factor receptor modulators}}
Category:Benzosulfones Category:Diphenyl ethers Category:Equine medications Category:Isocyanuric acids Category:Psychoplastogens Category:Trifluoromethyl compounds Category:TrkB agonists Category:Acylureas
{{antiinfective-drug-stub}} {{Veterinary-med-stub}}