{{chembox | Watchedfields = changed | verifiedrevid = 448394816 | Name = Pinotin A | ImageFile = Pinotin A.svg | ImageSize = 200px | ImageName = Chemical structure of pinotin A | ImageAlt = Chemical structure of pinotin A | IUPACName = | OtherNames = <!-- <br> --> |Section1={{Chembox Identifiers | CASNo = 663910-41-6 | CASNo_Ref = {{Cascite|changed|CAS}} | PubChem = 21674154 | ChemSpiderID = 10286568 | SMILES = COc1cc(cc(c1O)OC)c2c(c3c4c([o+]2)cc(cc4OC(=C3)c5ccc(c(c5)O)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O | StdInChI = 1S/C31H28O14/c1-40-21-6-13(7-22(41-2)25(21)36)29-30(45-31-28(39)27(38)26(37)23(11-32)44-31)15-10-18(12-3-4-16(34)17(35)5-12)42-19-8-14(33)9-20(43-29)24(15)19/h3-10,23,26-28,31-32,37-39H,11H2,1-2H3,(H3-,33,34,35,36)/p+1/t23-,26-,27+,28-,31+/m1/s1 | StdInChIKey = RFTHDRVOYDHSOC-BGXVWEPQSA-O | MeSHName = }} |Section2={{Chembox Properties | Formula = C<sub>31</sub>H<sub>29</sub>O<sub>14</sub>+ | MolarMass = 625.55 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = | GHS_ref =<!-- no GHS data in PubChem Dec2021 --> }} }} '''Pinotin A''' is a pinotin, a type of pyranoanthocyanins and a class of phenolic compounds found in red wine.<ref>Investigations on Anthocyanins in Wines from Vitis vinifera cv. Pinotage: Factors Influencing the Formation of Pinotin A and Its Correlation with Wine Age. Schwarz Michael, Hofmann Glenn and Winterhalter Peter, J. Agric. Food Chem., 2004, 52 (3): 498–504. {{doi|10.1021/jf035034f}}</ref><ref>Variation of pyranoanthocyanins in red wines of different varieties and vintages and the impact of pinotin A addition on their color parameters. Michael Rentzsch, Fabian Weber, Dominik Durner, Ulrich Fischer and Peter Winterhalter, European Food Research and Technology, Volume 229, Number 4, pp. 689-696, {{doi|10.1007/s00217-009-1102-4}}</ref>
== See also == * Pinotin A aglycone<ref>{{Cite web|url=http://www.phenol-explorer.eu/compounds/101|title = Showing dietary polyphenol Pinotin a aglycone - Phenol-Explorer}}</ref> * Phenolic content in wine
== References == {{reflist}}
== External links == * [http://www.phenol-explorer.eu/compounds/72 Pinotin A on www.phenol-explorer.eu]
{{Pyranoanthocyanidin}}
Category:Pyranoanthocyanins
{{aromatic-stub}}