Pindone

{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 464206843 | ImageFile_Ref = {{chemboximage|correct|??}} | ImageFile=Pindone.svg | PIN= 2-(2,2-Dimethylpropanoyl)-1''H''-indene-1,3(2''H'')-dione | OtherNames=2-Pivaloyl-1,3-indandione |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 6476 | InChI = 1/C14H14O3/c1-14(2,3)13(17)10-11(15)8-6-4-5-7-9(8)12(10)16/h4-7,10H,1-3H3 | InChIKey = RZKYEQDPDZUERB-UHFFFAOYAX | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C14H14O3/c1-14(2,3)13(17)10-11(15)8-6-4-5-7-9(8)12(10)16/h4-7,10H,1-3H3 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = RZKYEQDPDZUERB-UHFFFAOYSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo=83-26-1 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 2KFI1XBH7G | PubChem=6732 | KEGG_Ref = {{keggcite|changed|kegg}} | KEGG = C19141 | SMILES = O=C2c1ccccc1C(=O)C2C(=O)C(C)(C)C }} |Section2={{Chembox Properties | Formula=C₁₄H₁₄O₃ | MolarMass=230.26 g/mol | Appearance=Bright-yellow powder<ref name=PGCH/> | Odor = almost none | Density=1.06 g/mL | MeltingPtC=110 | BoilingPtC= | Solubility= 0.002% (25°C)<ref name=PGCH/> }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = | PEL = TWA 0.1 mg/m³<ref name=PGCH>{{PGCH|0516}}</ref> | IDLH = 100 mg/m³<ref name=PGCH/> | REL = TWA 0.1 mg/m³<ref name=PGCH/> | LD50 = 280 mg/kg (rat, oral)<br/>75 mg/kg (dog, oral)<br/>150 mg/kg (rabbit, oral)<ref>{{IDLH|83261|Pindone}}</ref> }} }}

'''Pindone''' is an organic compound. A derivative of 1,3-indandione, it is used as a rodenticide.<ref>{{cite book |last1=Buckle |first1=Alan |title=Ullmann's Encyclopedia of Industrial Chemistry |chapter=Rodenticides |date=2000 |doi=10.1002/14356007.a23_211 |isbn=3-527-30673-0 }}</ref> Its mode of action is as a anticoagulant.<ref name="pmid15694595">{{cite journal |vauthors=Robinson MH, Twigg LE, Wheeler SH, Martin GR |title=Effect of the anticoagulant, pindone, on the breeding performance and survival of merino sheep, Ovis aries |journal=Comp. Biochem. Physiol. B |volume=140 |issue=3 |pages=465–73 |date=March 2005 |pmid=15694595 |doi=10.1016/j.cbpc.2004.11.011 }}</ref> for agricultural use. It is commonly used as a rodenticide in the management of rat and rabbit populations.

It is pharmacologically analogous to warfarin and inhibits the synthesis of vitamin K-dependent clotting factors.

==References== {{reflist}}

{{rodenticides}}

Category:Vitamin K antagonists Category:Rodenticides Category:1,3-Indandiones Category:Anticoagulant rodenticides

{{agri-stub}} {{ketone-stub}}