{{Chembox | ImageFile = Picralinal.svg | ImageSize = | ImageAlt = | IUPACName = methyl (14E)-14-ethylidene-19-formyl-18-oxa-2,12-diazahexacyclo[9.6.1.1<sup>9,15</sup>.0<sup>1,9.</sup>0<sup>3,8</sup>.0<sup>12,17</sup>]nonadeca-3,5,7-triene-19-carboxylate | OtherNames = |Section1={{Chembox Identifiers | CASNo = 20045-06-1 | PubChem = 5320550 | ChemSpiderID = 10258953 | StdInChI=1S/C21H22N2O4/c1-3-12-10-23-16-8-14(12)19(11-24,18(25)26-2)20-9-17(23)27-21(16,20)22-15-7-5-4-6-13(15)20/h3-7,11,14,16-17,22H,8-10H2,1-2H3/b12-3- | StdInChIKey = RHBAENOZUZWALZ-BASWHVEKSA-N | SMILES = C/C=C\1/CN2C3CC1C(C45C3(NC6=CC=CC=C64)OC2C5)(C=O)C(=O)OC }} |Section2={{Chembox Properties | C=21 | H=22 | N=2 | O=4 | Formula = | MolarMass = | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Picralinal''' is a bio-active alkaloid from ''Alstonia scholaris'', a medicinal tree of West Africa.<ref>{{cite journal |title=A Review of the Ethnobotany and Pharmacological Importance of Alstonia boonei De Wild (Apocynaceae) | first1=John Prosper Kwaku | last1=Adotey|display-authors=etal|journal=ISRN Pharmacology | volume=2012 | date=2012 | doi=10.5402/2012/587160|pmid=22900200 |pmc=3413980 | article-number=587160 | doi-access=free }}</ref>
==References== {{reflist}}
{{Tryptamines}}
Category:Tryptamine alkaloids Category:Quinolizidine alkaloids Category:Methyl esters Category:Oxygen heterocycles Category:Heterocyclic compounds with 6 rings
{{alkaloid-stub}}