{{Chembox <!-- Images --> | ImageFile = Phomoxanthone B structure.svg | ImageSize = | ImageAlt = <!-- Names --> | Name = Phomoxanthone B | PIN = (5''R'',5′''R'',6''R'',6′''R'',10a''R'',10′a''R'')-10a,10′a-Bis[(acetyloxy)methyl]-1,1′,8,8′-tetrahydroxy-6,6′-dimethyl-9,9′-dioxo-5,5′,6,6′,7,7′,10a,10′a-octahydro-9''H'',9′''H''-[2,4′-bixanthene]-5,5′-diyl diacetate | OtherNames = PXB <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo1 = 359844-70-5 | CASNo1_Ref = <ref>{{cite web |title=KNApSAcK Metabolite Information - C00039993 |url=http://www.knapsackfamily.com/knapsack_core/information.php?word=C00039993 |website=www.knapsackfamily.com}}</ref>{{Cascite|changed|CAS}} | ChemSpiderID = 10213923 | PubChem = 10033009 | SMILES = CC1CC(=O)C2=C(C3=C(C=CC(=C3O)C4=C5C(=C(C=C4)O)C(=C6C(=O)CC(C(C6(O5)COC(=O)C)OC(=O)C)C)O)OC2(C1OC(=O)C)COC(=O)C)O | SMILES1 = [C@H]1(CC(=C2[C@@]([C@@H]1OC(=O)C)(Oc1c(C2=O)c(ccc1c1c(c2C(=O)C3=C(C[C@H]([C@H]([C@]3(Oc2cc1)COC(=O)C)OC(=O)C)C)O)O)O)COC(=O)C)O)C | SMILES2 = C[C@@H]1CC(=O)C2=C(C3=C(C=CC(=C3O)C4=C5C(=C(C=C4)O)C(=C6C(=O)C[C@H]([C@H]([C@]6(O5)COC(=O)C)OC(=O)C)C)O)O[C@@]2([C@@H]1OC(=O)C)COC(=O)C)O | ChEBI = 66750 | ChEMBL = 511092 | StdInChI=1S/C38H38O16/c1-15-11-25(45)30-33(48)28-26(53-37(30,13-49-17(3)39)35(15)51-19(5)41)10-8-21(31(28)46)22-7-9-23(43)27-32(47)29-24(44)12-16(2)36(52-20(6)42)38(29,54-34(22)27)14-50-18(4)40/h7-10,15-16,35-36,43,46-48H,11-14H2,1-6H3/t15-,16-,35-,36-,37+,38+/m1/s1 | StdInChIKey = RWPGIQJRECCQEK-ACMZUNAXSA-N }} | Section2 = {{Chembox Properties | Formula = C<sub>38</sub>H<sub>38</sub>O<sub>16</sub> | MolarMass = 750.70 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = not soluble | Solubility1 = good | Solvent1 = DMSO | Solubility2 = moderate | Solvent2 = EtOH }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

The mycotoxin '''phomoxanthone B''', or '''PXB''' for short, is a toxic natural product. It is a less toxic isomer of phomoxanthone A and one of the two founding members of the class of phomoxanthone compounds. The phomoxanthones are named after the fungus ''Phomopsis'', from which they were first isolated, and after their xanthonoid structure. Chemically, they are dimers of two tetrahydroxanthones that are covalently linked to each other. PXB itself is a homodimer of two identical diacetylated tetrahydroxanthones. The position of the link between the two tetrahydroxanthones is the only structural difference between PXB and its isomers PXA and dicerandrol C: In PXA, the two xanthonoid monomers are symmetrically linked at C-4,4’, while in PXB, they are asymmetrically linked at C-2,4’, and in dicerandrol C, they are symmetrically linked at C-2,2’.<ref name=Isaka2001>{{cite journal | last1 = Isaka | first1 = Masahiko | last2 = Jaturapat | first2 = Amonlaya | last3 = Rukseree | first3 = Kamolchanok | last4 = Danwisetkanjana | first4 = Kannawat | last5 = Tanticharoen | first5 = Morakot | last6 = Thebtaranonth | first6 = Yodhathai | title = Phomoxanthones A and B, Novel Xanthone Dimers from the Endophytic Fungus ''Phomopsis'' Species | journal = Journal of Natural Products | volume = 64 | issue = 8 | pages = 1015–8 | doi = 10.1021/np010006h | pmid = 11520217 | year = 2001}}</ref>

== References == {{Commons category|Phomoxanthone}} {{reflist}}

Category:Mycotoxins Category:Natural products Category:Xanthonoids