{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = | Watchedfields = | verifiedrevid = | IUPAC_name = [4-[4-[4-[2-[4-[Bis(2-chloroethyl)amino]phenyl]acetyl]oxyphenyl]hexan-3-yl]phenyl] 2-[4-[bis(2-chloroethyl)amino]phenyl]acetate | image = Phenestrol.svg | image_class = skin-invert-image | width = 250px
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!-- Identifiers --> | CAS_number_Ref = | CAS_number = 19659-38-2 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 161290 | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 141682 | UNII = | KEGG = | ChEBI = | ChEMBL = | synonyms = Fenestrol; NSC-183736; hexestrol bis[4-[bis(2-chloroethyl)amino]phenylacetate
<!--Chemical data--> | C=42 | H=48 | Cl=4 | N=2 | O=4 | SMILES = CCC(C1=CC=C(C=C1)OC(=O)CC2=CC=C(C=C2)N(CCCl)CCCl)C(CC)C3=CC=C(C=C3)OC(=O)CC4=CC=C(C=C4)N(CCCl)CCCl | StdInChI_Ref = | StdInChI = 1S/C42H48Cl4N2O4/c1-3-39(33-9-17-37(18-10-33)51-41(49)29-31-5-13-35(14-6-31)47(25-21-43)26-22-44)40(4-2)34-11-19-38(20-12-34)52-42(50)30-32-7-15-36(16-8-32)48(27-23-45)28-24-46/h5-20,39-40H,3-4,21-30H2,1-2H3 | StdInChIKey_Ref = | StdInChIKey = GTWGWCYJKHSRHO-UHFFFAOYSA-N }} {{Distinguish|Fenestrel}} '''Phenestrol''', or '''fenestrol''', also known as '''hexestrol bis[4-[bis(2-chloroethyl)amino]phenylacetate''', is a synthetic, nonsteroidal estrogen and cytostatic antineoplastic agent (i.e., chemotherapy drug) and a chlorphenacyl nitrogen mustard ester of hexestrol which was developed in the early 1960s for the treatment of hormone-dependent tumors but was never marketed.<ref name="Elks2014">{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA163|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=163–}}</ref><ref name="Goldin(U.S.)1981">{{cite book| veditors = Goldin A |author1=National Cancer Institute (U.S.)|author2=Onkologicheskiĭ nauchnyĭ t͡sentr (Akademii͡a medit͡sinskikh nauk SSSR) |title=Experimental evaluation of antitumor drugs in the USA and USSR and clinical correlations |url=https://books.google.com/books?id=auZ3FSFQiT4C|year=1981|publisher=U.S. Dept. of Health and Human Services, Public Health Service, National Institutes of Health, National Cancer Institute|page=17}}</ref><ref name="pmid6510335">{{cite journal | vauthors = Morozova TM, Merkulova TI, Martynov V, Iaguzhinskaia VP, Shkodinskaia EN | title = [Properties of alkylating derivatives of estrogens] | language = ru | journal = Eksperimental'naia Onkologiia | volume = 6 | issue = 2 | pages = 50–54 | year = 1984 | pmid = 6510335 }}</ref><ref name="pmid3201773">{{cite journal | vauthors = Lagova ND, Sof'ina ZP, Shkodinskaia EN, Kurdiumova KN, Valueva IM | title = [The antineoplastic activity of testiphenon] | language = ru | journal = Voprosy Onkologii | volume = 34 | issue = 11 | pages = 1363–1368 | year = 1988 | pmid = 3201773 }}</ref>
== See also == * List of hormonal cytostatic antineoplastic agents * List of estrogen esters
== References == {{Reflist}}
{{Estrogen receptor modulators}}
Category:Abandoned drugs Category:Antineoplastic drugs Category:Carboxylate esters Category:Estrogen esters Category:Hormonal antineoplastic drugs Category:Nitrogen mustards Category:Synthetic estrogens Category:Chloroethyl compounds
{{Antineoplastic-drug-stub}} {{Genito-urinary-drug-stub}}