{{Short description|GABAB receptor antagonist}} {{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 449584465 | ImageFile = Phaclofen.svg | ImageClass = skin-invert-image | ImageSize= | IUPACName=[3-amino-2-(4-chlorophenyl)propyl]phosphonic acid | OtherNames= |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo=108351-35-5 | PubChem=1641 | IUPHAR_ligand = 1091 | SMILES=C1=CC(=CC=C1C(CN)CP(=O)(O)O)Cl | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 1579 | InChI = 1/C9H13ClNO3P/c10-9-3-1-7(2-4-9)8(5-11)6-15(12,13)14/h1-4,8H,5-6,11H2,(H2,12,13,14) | InChIKey = VSGNGLJPOGUDON-UHFFFAOYAO | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C9H13ClNO3P/c10-9-3-1-7(2-4-9)8(5-11)6-15(12,13)14/h1-4,8H,5-6,11H2,(H2,12,13,14) | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = VSGNGLJPOGUDON-UHFFFAOYSA-N }} |Section2={{Chembox Properties | Formula=C<sub>9</sub>H<sub>13</sub>ClNO<sub>3</sub>P | MolarMass=249.631 g/mol | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }}
'''Phaclofen''', or '''phosphonobaclofen''', is a selective antagonist for the GABA<sub>B</sub> receptor.<ref>{{cite journal |title = Phaclofen: a peripheral and central baclofen antagonist |vauthors = Kerrn D, Ong J, Prager R, Gynther B, Curtis D |journal = Brain Research |volume = 405 |date = 3 March 1987 |issue = 1 |pages = 150–154 |doi=10.1016/0006-8993(87)90999-1|pmid = 3032346 |s2cid = 29595421 }}</ref> It was the first selective GABA<sub>B</sub> antagonist discovered, but its utility was limited by the fact that it does not cross the blood brain barrier.<ref>{{cite journal |journal=J Med Chem |title=Phosphinic acid analogues of GABA. 2. Selective, orally active GABAB antagonists |pmid=7650685 |date=August 18, 1995 |doi=10.1021/jm00017a016 |vauthors=Froestl W, Mickel SJ, von Sprecher G, Diel PJ, Hall RG, Maier L, Strub D, Melillo V, Baumann PA, Bernasconi R, et. al. |volume=38 |issue=17 |pages=3313–3331 }}</ref>
==References== {{Reflist|2}}
{{GABAergics}}
Category:GABAB receptor antagonists Category:Phosphonic acids Category:4-Chlorophenyl compounds {{nervous-system-drug-stub}}