{{Chembox | ImageFile = Peyonine.svg | ImageSize = | ImageAlt = | SystematicName = 1-[2-(3,4,5-Trimethoxyphenyl)ethyl]-1''H''-pyrrole-2-carboxylic acid | OtherNames = |Section1={{Chembox Identifiers | CASNo = 19717-25-0 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = KWD7M7UMPY | PubChem = 602258 | ChemSpiderID = 523536 | SMILES = COc1cc(cc(c1OC)OC)CCn2cccc2C(=O)O | InChI = 1/C16H19NO5/c1-20-13-9-11(10-14(21-2)15(13)22-3)6-8-17-7-4-5-12(17)16(18)19/h4-5,7,9-10H,6,8H2,1-3H3,(H,18,19) | InChIKey = DDYNENGLSGKEPO-UHFFFAOYAP | StdInChI = 1S/C16H19NO5/c1-20-13-9-11(10-14(21-2)15(13)22-3)6-8-17-7-4-5-12(17)16(18)19/h4-5,7,9-10H,6,8H2,1-3H3,(H,18,19) | StdInChIKey = DDYNENGLSGKEPO-UHFFFAOYSA-N}} |Section2={{Chembox Properties | Formula = C<sub>16</sub>H<sub>19</sub>NO<sub>5</sub> | MolarMass = 305.326 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Peyonine''' is a beta-phenethylpyrrole made by ''Lophophora''.<ref name="pmid5652132">{{cite journal | vauthors = Kapadia GJ, Highet RJ | title = Peyote alkaloids. IV. Structure of peyonine, novel beta-phenethylpyrrole from Lophophora williamsii | journal = Journal of Pharmaceutical Sciences | volume = 57 | issue = 1 | pages = 191–2 | date = January 1968 | pmid = 5652132 | doi = 10.1002/jps.2600570146 | url = }}</ref>
==References== {{Reflist}}
Category:Alkaloids Category:Lophophora {{Alkaloid-stub}}