{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 464198935 | Reference = <ref>[http://www.sigmaaldrich.com/catalog/search/ProductDetail/ALDRICH/359238 Perfluorooctane] at Sigma-Aldrich</ref> | ImageFile_Ref = {{chemboximage|correct|??}} | ImageFile = Perfluorooctane.png | ImageAlt = Structural formula of perfluorooctane | ImageFile1 = Perfluorooctane 3D spacefill.png | ImageAlt1 = Space-filling model of perfluorooctane | PIN = Octadecafluorooctane | OtherNames = PF5080 |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 9018 | InChI = 1/C8F18/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)26 | InChIKey = YVBBRRALBYAZBM-UHFFFAOYAG | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C8F18/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)26 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = YVBBRRALBYAZBM-UHFFFAOYSA-N | CASNo_Ref = {{cascite|changed|??}} | CASNo = 307-34-6 | EINECS = 206-199-2 | PubChem = 9387 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 6P60ZBK0QL | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 38826 | SMILES = FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F }} |Section2={{Chembox Properties | Formula =C<sub>8</sub>F<sub>18</sub> | MolarMass =438.06 g/mol | Appearance =Clear, colorless liquid | Density =1.766 g/mL | MeltingPtC = -25 | BoilingPtC = 103 to 104 | BoilingPt_notes = | Solubility =10 ppm }} |Section3={{Chembox Hazards | MainHazards =None | FlashPt =None | AutoignitionPt =None }} }}

'''Perfluorooctane''', also known as '''octadecafluorooctane''', is a fluorocarbon liquid&mdash;a perfluorinated derivative of the hydrocarbon octane. It can be a good substitute for insulating oil in high voltage electronics. In addition to heat transfer applications, it has also been used as a breathable fluid in partial liquid ventilation.<ref>{{cite journal| title=Breathing gas perfluorocarbon measurements using an absorber filled with zeolites| author=H. Proquitté| author2=M. Rüdiger| author3=R. R. Wauer| author4=G. Schmalisch| name-list-style=amp| journal=British Journal of Anaesthesia| year=2003| doi=10.1093/bja/aeg247| volume=91| pages=736–8| pmid=14570799| issue=5| doi-access=free}}</ref>

==Production== Perfluorooctane can be produced by the Fowler process or by electrochemical fluorination.

===Fowler process=== The Fowler process involves moderating the action of elemental fluorine with cobalt fluoride in the gas phase from octane.

===Electrochemical fluorination=== Electrolysis in hydrogen fluoride of nonanoic acid will produce both perfluorononanoic acid and perfluorooctane. Perfluorooctane manufactured this way is marketed under the name PF5080 (or FC77) by 3M as part of their Fluorinert range of heat transfer fluids.<ref>{{cite web| url=http://solutions.3m.com/wps/portal/3M/en_WW/electronics/home/productsandservices/products/ProductNavigator/Chemicals/?PC_7_RJH9U5230GE3E02LECIE20KAJ2_nid=7DPXKMZHBZbe68CXDBXGWDgl| title= 3M Performance Fluid PF-5080| publisher=3M}}</ref>

==Applications== Perfluorooctane is chemically inert, but has useful physical properties, leading to its employment in diverse areas: * Heat transfer agent<ref>{{cite web |url=http://tradelinemedical.net/perfluorooctane.htm |title=Tradeline Medical - Buy Medical Grade Perfluorooctane |website=tradelinemedical.net |url-status=dead |archive-url=https://web.archive.org/web/20140520220426/http://tradelinemedical.net/perfluorooctane.htm |archive-date=2014-05-20}} </ref> * Dielectric fluid * Tamponade in eye surgery<ref>{{cite journal | title = Retinal detachment surgery following implantation of a keratoprosthesis. A case report. | year = 1992 | vauthors= Claes C, Worst J, Zivojnovic R | journal = Bulletin de la Société Belge d'Ophtalmologie | volume = 243 | pages = 167–169 | pmid = 1302147 }}</ref>

== References == {{reflist}}

Category:Perfluoroalkanes Category:Halogenated solvents Category:Coolants