{{short description|Chemical compound}} {{Drugbox | Verifiedfields = | Watchedfields = | verifiedrevid = | IUPAC_name = 1-[(8''R'',9''S'',10''R'',13''S'',14''S'',17''R'')-3-cyclopentyloxy-17-hydroxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethanone | image = Pentagestrone.svg | image_class = skin-invert-image | width = 250px
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = | class = Progestogen ether
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number_Ref = | CAS_number = 7001-56-1 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | PubChem = 3047827 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 2310139 | UNII = L34YL185WL | ChEMBL = 2104801 | synonyms = 17α-Hydroxyprogesterone 3-cyclopentyl enol ether
<!--Chemical data--> | C=26 | H=38 | O=3 | SMILES = CC(=O)C1(CCC2C1(CCC3C2CC=C4C3(CCC(=C4)OC5CCCC5)C)C)O | StdInChI_Ref = | StdInChI = 1S/C26H38O3/c1-17(27)26(28)15-12-23-21-9-8-18-16-20(29-19-6-4-5-7-19)10-13-24(18,2)22(21)11-14-25(23,26)3/h8,16,19,21-23,28H,4-7,9-15H2,1-3H3/t21-,22+,23+,24+,25+,26+/m1/s1 | StdInChIKey_Ref = | StdInChIKey = RBFQPFFCDLXWQK-UXUCURBISA-N }}
'''Pentagestrone''' ({{abbrlink|INN|International Nonproprietary Name}}), also known as '''17α-hydroxyprogesterone 3-cyclopentyl enol ether''', is a steroidal progestin of the 17α-hydroxyprogesterone group that was never marketed.<ref name="Elks2014">{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA943|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=943–}}</ref><ref name="Wermuth2011">{{cite book| vauthors = Wermuth CG |title=The Practice of Medicinal Chemistry|url=https://books.google.com/books?id=Qmt1_DQkCpEC&pg=PA731|date=2 May 2011|publisher=Academic Press|isbn=978-0-08-056877-5|pages=731–|author-link=Camille Georges Wermuth}}</ref> An acetate ester, pentagestrone acetate (Gestovis, Gestovister), has been marketed for clinical use.<ref name="Elks2014" /> Pentagestrone was described in the literature in 1960.<ref name="Elks2014" />
==See also== * Quingestrone
==References== {{Reflist}}
{{Progesterone receptor modulators}}
Category:Abandoned drugs Category:Cyclopentyl ethers Category:Pregnanes Category:Progestogen ethers Category:Progestogens
{{genito-urinary-drug-stub}} {{Pregnanes-stub}}