{{Chembox | Reference = <ref name="Merck">''Merck Index'', 12th Edition, '''7136'''.</ref> | ImageFile = Pamoic acid.svg | ImageFile_Ref = {{Chemboximage|correct|??}} | ImageSize = | ImageName = Structural formula of pamoic acid | PIN = 4,4′-Methylenebis(3-hydroxynaphthalene-2-carboxylic acid) | OtherNames = 4,4′-Methylenebis(3-hydroxy-2-naphthoic acid)<br />Embonic acid |Section1={{Chembox Identifiers | IUPHAR_ligand = 2920 | CASNo = 130-85-8 | CASNo_Ref = {{cascite|correct|??}} | PubChem = 8546 | ChemSpiderID = 8228 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | UNII = 7RRQ8QZ38N | UNII_Ref = {{fdacite|correct|FDA}} | EINECS = 204-998-0 | MeSHName = Pamoic+acid | ChEBI = 50186 | ChEMBL = 177880 | ChEMBL_Ref = {{Ebicite|correct|EBI}} | RTECS = QL2180000 | Beilstein = 901319 | SMILES = OC(=O)C1=CC2=CC=CC=C2C(CC2=C(O)C(=CC3=CC=CC=C23)C(O)=O)=C1O | SMILES1 = C1=CC=C2C(=C1)C=C(C(=C2CC3=C(C(=CC4=CC=CC=C43)C(=O)O)O)O)C(=O)O | StdInChI = 1S/C23H16O6/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29/h1-10,24-25H,11H2,(H,26,27)(H,28,29) | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = WLJNZVDCPSBLRP-UHFFFAOYSA-N | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}}} |Section2={{Chembox Properties | C=23 | H=16 | O=6 | MeltingPt = ≥300 °C | pKa = 2.675 | LogP = 6.169}} |Section3={{Chembox Hazards | MainHazards = Causes skin irritation<br /> Causes serious eye irritation<br /> May cause respiratory irritation | GHSPictograms = | GHSSignalWord = | HPhrases = {{HPhrases|}} | PPhrases = {{PPhrases|}} | GHS_ref = <ref>GHS: [https://www.sigmaaldrich.com/product/ALDRICH/45150 Sigma Aldrich 45150] "Not a hazardous substance or mixture according to Regulation (EC) No. 1272/2008" (04-2019)</ref> }}}}

'''Pamoic acid''', also called '''embonic acid''', is a 2-Naphthoic acid derivative. Salts and esters of pamoic acid are known as '''pamoates''' or '''embonates'''. It can be prepared by the reaction of 3-hydroxy-2-naphthoic acid with formaldehyde.

In pharmacology, the salt form of pamoic acid (pamoate ion) can be used as a counterion of a drug compound to affect the dissolution rate of the drug.<ref>{{cite journal | pmid = 2102266 | year = 1990 | last1 = Saesmaa | first1 = T | last2 = Tötterman | first2 = AM | title = Dissolution studies on ampicillin embonate and amoxycillin embonate | volume = 8 | issue = 1 | pages = 61–5 | journal = Journal of Pharmaceutical and Biomedical Analysis | doi=10.1016/0731-7085(90)80007-c}}</ref> The presence of multiple oxygen atoms enables significant hydrogen bonding to occur. Hydrogen bonds facilitate the dissolution of compounds in water. Pharmaceutical drugs formulated this way include cycloguanil pamoate, hydroxyzine pamoate, imipramine pamoate, olanzapine pamoate hydrate, oxantel pamoate, pyrantel pamoate, and pyrvinium pamoate.

Pamoic acid has agonist activity for the orphan G protein-coupled receptor GPR35 by which it activates ERK and beta-arrestin2, and causes antinociceptive activity.<ref>{{cite journal | doi = 10.1124/mol.110.066746 | title = Targeting of the Orphan Receptor GPR35 by Pamoic Acid: A Potent Activator of Extracellular Signal-Regulated Kinase and -Arrestin2 with Antinociceptive Activity | year = 2010 | last1 = Zhao | first1 = P. | last2 = Sharir | first2 = H. | last3 = Kapur | first3 = A. | last4 = Cowan | first4 = A. | last5 = Geller | first5 = E. B. | last6 = Adler | first6 = M. W. | last7 = Seltzman | first7 = H. H. | last8 = Reggio | first8 = P. H. | last9 = Heynen-Genel | first9 = S. | last10 = Sauer | first10 = M. | last11 = Chung | first11 = T. D. Y. | last12 = Bai | first12 = Y. | last13 = Chen | first13 = W. | last14 = Caron | first14 = M. G. | last15 = Barak | first15 = L. S. | last16 = Abood | first16 = M. E. | journal = Molecular Pharmacology | volume = 78 | issue = 4 | pages = 560–8 | pmid = 20826425 | pmc = 2981393| display-authors = 8 }}</ref><ref>{{cite journal | author = Neubig, Richard R | title = Mind your salts: when the inactive constituent isn't | journal = Molecular Pharmacology | year = 2010 | volume = 78 | issue = 4 | pages = 558–9 | doi = 10.1124/mol.110.067645 | pmid = 20651116| s2cid = 1859819 }}</ref>

== References == {{reflist}}

Category:Dicarboxylic acids Category:2-Naphthols Category:Naphthoic acids Category:Alpha hydroxycarboxylic acids Category:Diols