{{More citations needed|date=May 2019}} {{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 444775363 | ImageFile = Oxalbernsteinsäure.png | ImageClass = skin-invert | PIN = 1-Oxopropane-1,2,3-tricarboxylic acid | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 1948-82-9 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = DFK99PW32K | PubChem = 972 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 7815 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 947 | RTECS = | MeSHName = | KEGG_Ref = {{keggcite|changed|kegg}} | KEGG = C05379 | SMILES = C(C(C(=O)C(=O)O)C(=O)O)C(=O)O | InChI = 1/C6H6O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2H,1H2,(H,7,8)(H,10,11)(H,12,13) | InChIKey = UFSCUAXLTRFIDC-UHFFFAOYAK | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C6H6O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2H,1H2,(H,7,8)(H,10,11)(H,12,13) | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = UFSCUAXLTRFIDC-UHFFFAOYSA-N }} |Section2={{Chembox Properties | C=6 | H=6 | O=7 | MolarMass = 190.108 | Appearance = | Density = | MeltingPt = | BoilingPt = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Oxalosuccinic acid''' is a substrate of the citric acid cycle. It is acted upon by isocitrate dehydrogenase. Salts and esters of oxalosuccinic acid are known as '''oxalosuccinates'''.
Oxalosuccinic acid/oxalosuccinate is an unstable 6-carbon intermediate in the tricarboxylic acid cycle. It's a keto acid, formed during the oxidative decarboxylation of isocitrate to alpha-ketoglutarate, which is catalyzed by the enzyme isocitrate dehydrogenase. Isocitrate is first oxidized by coenzyme NAD+ to form oxalosuccinic acid/oxalosuccinate.<ref>{{cite journal | vauthors = Ochoa S | title = Biosynthesis of tricarboxylic acids by carbon dioxide fixation; the preparation and properties of oxalosuccinic acid | journal = The Journal of Biological Chemistry | volume = 174 | issue = 1 | pages = 115–22 | date = May 1948 | doi = 10.1016/S0021-9258(18)57381-6 | pmid = 18914069 | doi-access = free }}</ref> Oxalosuccinic acid is both an alpha-keto and a beta-keto acid (an unstable compound) and it is the beta-ketoic property that allows the loss of carbon dioxide in the enzymatic reaction in conversion to the five-carbon molecule 2-oxoglutarate.<ref>{{cite journal | vauthors = Romkina AY, Kiriukhin MY | title = Biochemical and molecular characterization of the isocitrate dehydrogenase with dual coenzyme specificity from the obligate methylotroph Methylobacillus Flagellatus | journal = PLOS ONE | volume = 12 | issue = 4 | article-number = e0176056 | date = 2017-04-19 | pmid = 28423051 | pmc = 5397045 | doi = 10.1371/journal.pone.0176056 | bibcode = 2017PLoSO..1276056R | doi-access = free }}</ref>
==References== <references />{{Citric acid cycle}}
{{DEFAULTSORT:Oxalosuccinic Acid}} Category:Tricarboxylic acids Category:Alpha-keto acids Category:Beta-keto acids
{{biochemistry-stub}}