{{Short description|Chemical compound}} {{Distinguish|ronidazole}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 447378516 | drug_name = | type = | IUPAC_name = 1-Chloro-3-(2-methyl-5-nitro-1''H''-imidazol-1-yl)propan-2-ol | image = Ornidazole.svg | image_class = skin-invert-image
<!--Clinical data-->| alt = | caption = | tradename = '''Xynor''' | Drugs.com = {{drugs.com|international|ornidazole}} | MedlinePlus = | licence_EU = | licence_US = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_status = | routes_of_administration = Oral
<!--Pharmacokinetic data-->| bioavailability = | metabolism = Via liver<ref name=":0" />{{Rp|1356}} | elimination_half-life = 12-13 hours<ref name=":0" />{{Rp|1356}} | excretion = Urine (63%) and Feces (22%)
<!--Identifiers-->| CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 16773-42-5 | ATC_prefix = G01 | ATC_suffix = AF06 | ATC_supplemental = {{ATC|J01|XD03}} {{ATC|P01|AB03}} {{ATCvet|P51|AA03}} | PubChem = 28061 | DrugBank = DB13026 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 26102 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1449676 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 62XCK0G93T | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D05274 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 75176
<!--Chemical data-->| C = 7 | H = 10 | Cl = 1 | N = 3 | O = 3 | smiles = [O-][N+](=O)c1cnc(n1CC(O)CCl)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C7H10ClN3O3/c1-5-9-3-7(11(13)14)10(5)4-6(12)2-8/h3,6,12H,2,4H2,1H3 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = IPWKIXLWTCNBKN-UHFFFAOYSA-N }}
'''Ornidazole''' is an antibiotic used to treat protozoan infections.<ref name=":0">{{cite book | vauthors = Kuhlmann FM, Fleckenstein JM | chapter = 157 - Antiparasitic Agents|date=2017-01-01|chapter-url=http://www.sciencedirect.com/science/article/pii/B978070206285800157X | veditors = Cohen J, Powderly WG, Opal SM |title =Infectious Diseases | edition = Fourth |pages=1345–1372.e2 |publisher=Elsevier| doi = 10.1016/B978-0-7020-6285-8.00157-X|isbn=978-0-7020-6285-8 }}</ref>{{Rp|1368}} A synthetic nitroimidazole, it is commercially obtained from an acid-catalyzed reaction between 2-methyl-5-nitroimidazole and epichlorohydrin. <ref>{{cite book | name-list-style = vanc | vauthors = Sharma S, Anand N | chapter = Chapter 17 - Nitroheterocycles |date= January 1997 | title = Pharmacochemistry Library |volume=25 |pages=428 | veditors = Sharma S, Anand N|series=Approaches to Design and Synthesis of Antiparasitic Drugs |publisher=Elsevier |doi=10.1016/S0165-7208(97)80039-6 |isbn=9780444894762 }}</ref> Ornidazole is nothing but chloro-secnidazole.
Antimicrobial spectrum is similar to that of metronidazole and is more well tolerated;<ref name=":0" />{{Rp|1368}} however there are concerns of lower relative efficacy.<ref>{{cite book | vauthors = Nagel JL, Aronoff DM | chapter = 28 - Metronidazole|date= January 2015 | veditors = Bennett JE, Dolin R, Blaser MJ | title = Mandell, Douglas, and Bennett's Principles and Practice of Infectious Diseases | edition = Eighth |pages=356 |publisher=Content Repository Only!|isbn=978-1-4557-4801-3 }}</ref>
It was first introduced for treating trichomoniasis before being recognized for its broad anti-protozoan and anti-anaerobic-bacterial capacities.<ref>{{Citation| vauthors = Wilcox MH | chapter = 147 - Nitroimidazoles, Metronidazole, Ornidazole and Tinidazole; and Fidaxomicin |date= January 2017 | veditors = Cohen J, Powderly WG, Opal SM | title = Infectious Diseases | edition = Fourth |pages=1261–1263.e1 |publisher=Elsevier|isbn=978-0-7020-6285-8 }}</ref>{{Rp|1261}} has also been investigated for use in Crohn's disease after bowel resection.<ref name="pmid15825069">{{cite journal | vauthors = Rutgeerts P, Van Assche G, Vermeire S, D'Haens G, Baert F, Noman M, Aerden I, De Hertogh G, Geboes K, Hiele M, D'Hoore A, Penninckx F | display-authors = 6 | title = Ornidazole for prophylaxis of postoperative Crohn's disease recurrence: a randomized, double-blind, placebo-controlled trial | journal = Gastroenterology | volume = 128 | issue = 4 | pages = 856–861 | date = April 2005 | pmid = 15825069 | doi = 10.1053/j.gastro.2005.01.010 | doi-access = free }}</ref>
== References == {{Reflist}}
{{Other antibacterials}} {{Gynecological anti-infectives and antiseptics}} {{Agents against amoebozoa}} {{Authority control}}
Category:Antiprotozoal agents Category:Disulfiram-like drugs Category:Poultry diseases Category:Nitroimidazole antibiotics Category:Organochlorides Category:Halohydrins
{{antiinfective-drug-stub}} {{genito-urinary-drug-stub}}