{{Chembox <!-- Images --> | ImageFile = Nyasol.svg | ImageClass = skin-invert-image | ImageSize = 200px | ImageAlt = <!-- Names --> | IUPACName = 4,4'-[(1''Z'',3''R'')-3-Ethenyl-1-propene-1,3-diyl]bis[phenol] | OtherNames = ''cis''-Hinokiresinol; (''Z'')-Hinokiresinol <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo = 96895-25-9 | ChEBI = 67889 | ChEMBL = 451713 | ChemSpiderID = 5291646 | PubChem = 6915833 | UNII = LK6CH9D7UR | SMILES = C=C[C@H](/C=C\C1=CC=C(C=C1)O)C2=CC=C(C=C2)O | StdInChI = 1S/C17H16O2/c1-2-14(15-7-11-17(19)12-8-15)6-3-13-4-9-16(18)10-5-13/h2-12,14,18-19H,1H2/b6-3-/t14-/m1/s1 | StdInChIKey = VEAUNWQYYMXIRB-JHAQOBCDSA-N }} | Section2 = {{Chembox Properties | C=17 | H=16 | O=2 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Nyasol''', also known as '''''cis''-hinokiresinol''' or as '''(''Z'')-hinokiresinol''', is a lignan that is found in ''Anemarrhena asphodeloides''.<ref name="Buckingham1986">{{cite book|author=J. Buckingham|title=Dictionary of Organic Compounds|url=https://books.google.com/books?id=x2Su3GKCvtsC&pg=PA3544|year=1986|publisher=CRC Press|isbn=978-0-412-54090-5|pages=3544–}}</ref><ref name="Atta-ur-Rahman2003">{{cite book|author=Atta-ur-Rahman|title=Studies in Natural Products Chemistry: Bioactive Natural Products|url=https://books.google.com/books?id=B_-T5z78tXQC&pg=PA234|date=8 July 2003|publisher=Elsevier|isbn=978-0-08-054205-8|pages=234–}}</ref><ref name="Wiart2012">{{cite book|author=Christophe Wiart|title=Medicinal Plants of China, Korea, and Japan: Bioresources for Tomorrow's Drugs and Cosmetics|url=https://books.google.com/books?id=ckTOBQAAQBAJ&pg=PA135|date=11 May 2012|publisher=CRC Press|isbn=978-1-4398-9912-0|pages=135–}}</ref><ref name="KwonKondaji2013">Kwon, J., Kondaji, G., Song, S., Kim, C., Lee, K., Kim, W. K., & Choi, Y. (2013). Synthesis of naturally occurring norlignan (±)-nyasol. Bulletin of the Korean Chemical Society, 34(4), 1247-1249.</ref> It has estrogenic activity, acting as a selective agonist of the ERβ,<ref name="YangBaggett2008">{{cite journal|last1=Yang|first1=H|last2=Baggett|first2=S|last3=Staub|first3=R|last4=Chow|first4=S|last5=Bjeldanes|first5=LF|last6=Leitman|first6=D|last7=Cohen|first7=I|title=Norlignans from Anemarrhenae asphoeloides Displaying Selective Estrogen Beta (ER?) Activity|journal=Planta Medica|volume=74|issue=3|year=2008|issn=0032-0943|doi=10.1055/s-2008-1075274|bibcode=2008PlMed..7475274Y}}</ref> and hence is a phytoestrogen.<ref name="RahmanReitz2005">{{cite book|author1=Atta-ur- Rahman|author2=Allen B. Reitz|title=Frontiers in Medicinal Chemistry|url=https://books.google.com/books?id=tCyDoIHToBQC&pg=PA205|date=1 January 2005|publisher=Bentham Science Publishers|isbn=978-1-60805-205-9|pages=205–}}</ref><ref name="pmid10726863">{{cite journal | vauthors = Minami E, Taki M, Takaishi S, Iijima Y, Tsutsumi S, Akiyama T | title = Stereochemistry of cis- and trans-hinokiresinol and their estrogen-like activity | journal = Chem. Pharm. Bull. | volume = 48 | issue = 3 | pages = 389–92 | year = 2000 | pmid = 10726863 | doi = 10.1248/cpb.48.389| doi-access = free }}</ref><ref name="KwonKondaji2013" /> In addition, (-)-nyasol has been found to inhibit the production of eicosanoids and nitric oxide ''in vitro'' and shows anti-inflammatory effects.<ref name="pmid20091263">{{cite journal | vauthors = Lim H, Nam JW, Seo EK, Kim YS, Kim HP | title = (-)-Nyasol (cis-hinokiresinol), a norneolignan from the rhizomes of Anemarrhena asphodeloides, is a broad spectrum inhibitor of eicosanoid and nitric oxide production | journal = Arch. Pharm. Res. | volume = 32 | issue = 11 | pages = 1509–14 | year = 2009 | pmid = 20091263 | doi = 10.1007/s12272-009-2102-4 | s2cid = 23151318 }}</ref>
==References== {{Reflist|2}}
{{Lignans}} {{Phytoestrogens}} {{Estrogen receptor modulators}}
Category:Lignans Category:Phytoestrogens Category:Selective ERβ agonists Category:4-Hydroxyphenyl compounds
{{organic-compound-stub}}