{{Chembox <!-- Images --> | ImageFile = 19-Norpregnane.svg | ImageClass = skin-invert-image | ImageSize = 200px | ImageAlt = <!-- Names --> | IUPACName = 17β-Ethyl-5ξ-estrane | SystematicName = (1''S'',3a''S'',3b''R'',5a''Ξ'',9a''S'',9b''R'',11a''R'')-1-Ethyl-11a-methylhexadecahydro-1''H''-cyclopenta[''a'']phenanthrene | OtherNames = 13β-Methyl-17β-ethylgonane <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo = | PubChem = 53649607 | StdInChI = 1S/C20H34/c1-3-15-9-11-19-18-10-8-14-6-4-5-7-16(14)17(18)12-13-20(15,19)2/h14-19H,3-13H2,1-2H3/t14?,15-,16-,17+,18+,19-,20+/m0/s1 | StdInChIKey = ALSXNTIVNJBNQE-ZWONNITHSA-N | SMILES = CC[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4[C@@H]3CCCC4)C | ChemSpiderID = 58838804
}} | Section2 = {{Chembox Properties | C=20 | H=34 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''19-Norpregnane''', also known as '''13β-methyl-17β-ethylgonane''', is a norsteroid and the 19-demethyl analogue of pregnane. It is the parent compound of 19-norprogesterone (19-norpregn-4-ene-3,20-dione) and derivatives of it such as the progestins demegestone, gestonorone caproate (gestronol hexanoate), nomegestrol acetate, norgestomet, promegestone, segesterone acetate (nestorone), and trimegestone.<ref name="FRCOG2015">{{cite book|editor=Howard J.A. Carp|title=Progestogens in Obstetrics and Gynecology|url=https://books.google.com/books?id=Ik8SCAAAQBAJ&pg=PA35|date=9 April 2015|publisher=Springer|isbn=978-3-319-14385-9|pages=35–}}</ref>
==See also== * Gonane * Androstane * Estrane
==References== {{Reflist}}
{{Steroid classification}}
{{DEFAULTSORT:Norpregnane, 19-}}
Category:Norpregnanes
{{steroid-stub}}