{{Chembox | ImageFile = Nitidine.svg | ImageSize = 250px | ImageAlt = Chemical structure of nitidine | PIN = 2,3-Dimethoxy-12-methyl-9''H''-[1,3]benzodioxolo[5,6-''c'']phenanthridin-12-ium | OtherNames = |Section1={{Chembox Identifiers | CASNo = 6872-57-7 | CASNo_Ref = {{cascite|correct|CAS}} | ChEBI = 7578 | ChEMBL = 176008 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 933301178Z | KEGG = C09595 | PubChem = 4501 | SMILES = C[N+]1=CC2=CC(=C(C=C2C3=C1C4=CC5=C(C=C4C=C3)OCO5)OC)OC | ChemSpiderID = 4345 | InChI = 1/C21H18NO4/c1-22-10-13-7-17(23-2)18(24-3)8-15(13)14-5-4-12-6-19-20(26-11-25-19)9-16(12)21(14)22/h4-10H,11H2,1-3H3/q+1 | InChIKey = KKMPSGJPCCJYRV-UHFFFAOYAL | StdInChI = 1S/C21H18NO4/c1-22-10-13-7-17(23-2)18(24-3)8-15(13)14-5-4-12-6-19-20(26-11-25-19)9-16(12)21(14)22/h4-10H,11H2,1-3H3/q+1 | StdInChIKey = KKMPSGJPCCJYRV-UHFFFAOYSA-N }} |Section2={{Chembox Properties | Formula = C<sub>21</sub>H<sub>18</sub>NO<sub>4</sub><sup>+</sup> | MolarMass = 348.37 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Nitidine''' is a benzophenanthridine alkaloid found in species of the genus ''Zanthoxylum'', notably in ''Zanthoxylum nitidum''. This compound has an anti-malarial activity.<ref name=bouquet>Bouquet, J., et al. (2012). [http://www.malariajournal.com/content/11/1/67/ Biological activities of nitidine, a potential anti-malarial lead compound.] ''Malaria Journal'' 11:67</ref>
== References == {{reflist}}
Category:Isoquinoline alkaloids Category:Benzodioxoles Category:Quinoline alkaloids Category:Alkaloids found in Rutaceae Category:Antimalarial agents Category:Methoxy compounds Category:Heterocyclic compounds with 5 rings
{{alkaloid-stub}}