Nitecapone

{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = 3-[(3,4-Dihydroxy-5-nitrophenyl)methylidene]pentane-2,4-dione | image = Nitecapone.svg | image_class = skin-invert-image | alt = Skeletal formula | width = 200 | image2 = Nitecapone molecule spacefill.png | image_class2 = bg-transparent | alt2 = Space-filling model | CAS_number = 116313-94-1 | CAS_supplemental = | ATC_prefix = None | ATC_suffix = | PubChem = 5464105 | ChemSpiderID = 4576539 | KEGG = D03241 | UNII = 98BS722498 | ChEMBL = 167055 | C=12 | H=11 | N=1 | O=6 | SMILES = [O-][N+](=O)c1cc(\C=C(/C(=O)C)C(=O)C)cc(O)c1O | StdInChI = 1S/C12H11NO6/c1-6(14)9(7(2)15)3-8-4-10(13(18)19)12(17)11(16)5-8/h3-5,16-17H,1-2H3 | StdInChIKey = UPMRZALMHVUCIN-UHFFFAOYSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_category = | legal_status = | routes_of_administration = }}

'''Nitecapone''' (INN; '''OR-462''') is a drug which acts as a selective inhibitor of the enzyme catechol ''O''-methyl transferase (COMT).<ref name="Macdonald1997">{{cite book | author = F.. Macdonald | title = Dictionary of Pharmacological Agents | url = https://books.google.com/books?id=A0THacd46ZsC&pg=PA1435 | access-date = 20 May 2012 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 1635}}</ref><ref name="pmid3181288">{{cite journal |vauthors=Nissinen E, Lindén IB, Schultz E, Kaakkola S, Männistö PT, Pohto P | title = Inhibition of catechol-O-methyltransferase activity by two novel disubstituted catechols in the rat | journal = European Journal of Pharmacology | volume = 153 | issue = 2–3 | pages = 263–9 |date=August 1988 | pmid = 3181288 | doi = 10.1016/0014-2999(88)90614-0}}</ref> It was patented as an antiparkinson medication but was never marketed.<ref name="Macdonald1997" />

==References== {{Reflist}}

Category:Antiparkinsonian agents Category:Catechol-O-methyltransferase inhibitors Category:Catechols Category:Diketones Category:Nitrophenol derivatives