Narceine

{{Chembox | verifiedrevid = | ImageFile = Narceine.svg | ImageClass = skin-invert-image | ImageSize = | PIN = 6-({6-[2-(Dimethylamino)ethyl]-4-methoxy-2''H''-1,3-benzodioxol-5-yl}acetyl)-2,3-dimethoxybenzoic acid | OtherNames = |Section1={{Chembox Identifiers | Abbreviations = | UNII_Ref = | UNII = CTT09X2F1M | ChEMBL = | StdInChI = 1S/C23H27NO8/c1-24(2)9-8-13-10-18-22(32-12-31-18)20(29-4)15(13)11-16(25)14-6-7-17(28-3)21(30-5)19(14)23(26)27/h6-7,10H,8-9,11-12H2,1-5H3,(H,26,27) | StdInChIKey = DEXMFYZAHXMZNM-UHFFFAOYSA-N | CASNo_Ref = | CASNo = 131-28-2 | EINECS = 235-480-2 | PubChem = 8564 | ChemSpiderID = 8246 | SMILES = CN(C)CCC1=CC2=C(C(=C1CC(=O)C3=C(C(=C(C=C3)OC)OC)C(=O)O)OC)OCO2 | InChI = 1/C23H27NO8/c1-24(2)9-8-13-10-18-22(32-12-31-18)20(29-4)15(13)11-16(25)14-6-7-17(28-3)21(30-5)19(14)23(26)27/h6-7,10H,8-9,11-12H2,1-5H3,(H,26,27) | InChIKey = DEXMFYZAHXMZNM-UHFFFAOYAJ | RTECS = | MeSHName = | ChEBI = | KEGG = C09591 }} |Section2={{Chembox Properties | C=23 | H=27 | N=1 | O=8 | MolarMass = | Appearance = | Density = | MeltingPt = | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | Solubility = | SolubleOther = | Solvent = | pKa = | pKb = }} |Section3={{Chembox Pharmacology | ProteinBound = | Bioavail = | Metabolism = | HalfLife = | Excretion = | Pregnancy_category = | Pregnancy_US = | Pregnancy_AU = | Legal_US = | Legal_UK = | Legal_AU = | Legal_CA = | Legal_status = | AdminRoutes = | Licence_EU = | Licence_US = | Dependence_liability = }} }}

'''Narceine''' (also spelled '''narcein'''<ref>{{cite web |title=Narceine |url=https://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=13150 |website=Guide to Pharmacology |access-date=2026-03-24}}</ref> and '''narceen'''<ref>{{cite web |title=Narceine |url=https://www.collinsdictionary.com/dictionary/english/narceine |publisher=Collins English Dictionary |access-date=2026-03-04}}</ref>) is an opium alkaloid produced by the ''Papaver somniferum'' (opium poppy) plant.<ref>{{cite journal | title = Investigations on poppies | author = van Itallie, L. | journal = Annales Pharmaceutiques Françaises | year = 1946 | volume = 4 | pages = 156–160}}</ref> It is a bitter, crystalline compound with narcotic effects.{{citation needed|date=January 2015}} It was formerly used as a substitute for morphine.{{medcn|date=January 2015}} Its name is derived from the Greek {{lang|grc|νάρκη}} (''nárkē''), meaning numbness, and the postfix ''-ine'' referring to an alkaloid.

==See also== *Noscapine, a related alkaloid

==References== {{reflist}}

Category:Methylenedioxyphenethylamines Category:Natural opium alkaloids Category:Piceol ethers Category:Pyrogallol ethers Category:Salicylyl ethers Category:Dimethylamino compounds