Morphinone

{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 462255579 | ImageFile = Morphinone.svg | ImageClass = skin-invert-image | ImageName = Structural formula | ImageFile1 = Morphinone molecule spacefill.png | ImageClass1 = bg-transparent | ImageName1 = Space-filling model | IUPACName = (5α)-3-Hydroxy-17-methyl-7,8-didehydro-4,5-epoxy-morphinan-6-one | OtherNames = |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4573586 | InChI = 1/C17H17NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,16,19H,6-8H2,1H3/t10-,11+,16-,17-/m0/s1 | InChIKey = PFBSOANQDDTNGJ-YNHQPCIGBO | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C17H17NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,16,19H,6-8H2,1H3/t10-,11+,16-,17-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = PFBSOANQDDTNGJ-YNHQPCIGSA-N | CASNo_Ref = {{cascite|changed|??}} | CASNo = 467-02-7 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 255467 | PubChem = 5459823 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 28MBK63MAW | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 16315 | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = C01735 | SMILES = O=C1\C=C/[C@H]5[C@@H]4N(CC[C@@]52c3c(O[C@@H]12)c(O)ccc3C4)C }} |Section2={{Chembox Properties | C=17 | H=17 | N=1 | O=3 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Morphinone''' is an opioid that is the intermediate when morphine is being converted to hydromorphone (trade name Dilaudid).<ref>{{cite book | title = Comprehensive Natural Products III | isbn = 978-0-08-102691-5 | editor = Hung-Wen (Ben) Liu and Tadhg P. Begley | date = 2020 | publisher = Elsevier }}</ref>

== Chemical structure == Morphinone can be described as the ketone of morphine.

== Legal status == Morphinone itself is an active opioid, though its potency is closer to codeine than morphine.{{cn|date=February 2023}} It is, however, an important precursor and would fall under the purview of the Controlled Substances Act within the United States. Its legal status in other countries varies.

==References== {{Reflist}}

Category:4,5-Epoxymorphinans Category:Semisynthetic opioids Category:Mu-opioid receptor agonists Category:Enones Category:Hydroxyarenes