{{Short description|NSAID analgesic drug}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 458950781 | IUPAC_name = 1,5-dimethyl-4-[(3-methyl-2-phenylmorpholin-4-yl)methyl]-2-phenyl-1,2-dihydro-3''H''-pyrazol-3-one | image = Morazone.svg | image_class = skin-invert-image | width = 250px

<!--Clinical data--> | tradename = | pregnancy_category = | legal_status = Rx-only | routes_of_administration = Oral, SC, IM<ref name="isbn0-7923-0964-2">{{ cite book | vauthors = Seyffart G | title = Drug dosage in Renal Insufficiency | publisher = Kluwer Academic Publishers | location = Boston | year = 1991 | page = 399 | isbn = 978-0-7923-0964-2 | url = https://books.google.com/books?id=FubgMz6aOWAC&q=morazone&pg=PA399 }}</ref>

<!--Pharmacokinetic data--> | bioavailability = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number_Ref = {{cascite|changed|??}} | CAS_number = 6536-18-1 | ATC_prefix = none | ATC_suffix = | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C23H27N3O2/c1-17-21(23(27)26(24(17)3)20-12-8-5-9-13-20)16-25-14-15-28-22(18(25)2)19-10-6-4-7-11-19/h4-13,18,22H,14-16H2,1-3H3 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = OOGNFQMTGRZRAB-UHFFFAOYSA-N | PubChem = 39609 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 36216 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 870Q5BL2FN

<!--Chemical data--> | C=23 | H=27 | N=3 | O=2 | smiles = c1ccccc1N2N(C)C(C)=C(C2=O)CN3CCOC(C3C)c4ccccc4 }}

'''Morazone''' ('''Novartrina''', '''Orsimon''', '''Rosimon-Neu''', '''Tarcuzate''') is a nonsteroidal anti-inflammatory drug (NSAID), originally developed by the German pharmaceutical company Ravensberg in the 1950s, which is used as an analgesic.<ref name="isbn0-7923-0964-2"/><ref>{{cite patent | country = US | status = patent | number = 2943022 | gdate = 1960-06-28 | invent1 = Siemer, H. | invent2 = Doppstadt, A. | assign1 = Ravensberg | title = Substituted 1-phenyl-2,3-dimethyl-4-morpholino methyl pyrazolone-(5) Compounds and Process of Making Same }}</ref><ref name="isbn0-412-54090-8">{{cite book | veditors = Buckingham J | title = Dictionary of Organic Compounds | volume = 7 | publisher = Chapman & Hall | location = London | year = 1996 | page = 4659 | isbn = 978-0-412-54090-5 | url = https://books.google.com/books?id=r7z8W69GcoMC&pg=PA4659 }}</ref> It produces phenmetrazine as a major metabolite and has been reported to have been abused as a recreational drug in the past.<ref name="pmid989292"> {{cite journal | vauthors = Bohn G, Rücker G, Kröger H | title = [Investigations of the decomposition and detection of morazone by thin-layer- and gas-liquid-chromatography] | journal = Archives of Toxicology | volume = 35 | issue = 3 | pages = 213–20 | date = June 1976 | pmid = 989292 | doi = 10.1007/bf00293569 | s2cid = 23956851 }}</ref><ref name="pmid16867765">{{cite journal | vauthors = Neugebauer M | title = Some new urinary metabolites of famprofazone and morazone in man | journal = Journal of Pharmaceutical and Biomedical Analysis | volume = 2 | issue = 1 | pages = 53–60 | year = 1984 | pmid = 16867765 | doi = 10.1016/0731-7085(84)80089-8 }}</ref><ref name="pmid6145264">{{cite journal | vauthors = Kingreen JC, Breger G | title = [Pellagra in morazone abuse] | journal = Zeitschrift für Hautkrankheiten | volume = 59 | issue = 9 | pages = 573–7 | date = May 1984 | pmid = 6145264 }}</ref><ref name="pmid5081964">{{cite journal | vauthors = Daunderer M, Janzen W | title = [ROSIMON-NEU--a non-prescription analgesic on the adolescent drug scene] | journal = Beiträge zur Gerichtlichen Medizin | volume = 29 | pages = 138–43 | year = 1972 | pmid = 5081964 }}</ref>

== See also == * Famprofazone * Morforex

== References == {{Reflist|30em}}

{{Anti-inflammatory products}} {{Analgesics}} {{Stimulants}} {{Monoamine releasing agents}} {{Phenethylamines}}

Category:Beta-Hydroxyamphetamines Category:Designer prodrugs Category:Nonsteroidal anti-inflammatory drugs Category:Norepinephrine-dopamine releasing agents Category:Phenylmorpholines Category:Pyrazolones Category:Stimulants