{{Chembox | ImageFile = Morantel.svg | ImageClass = skin-invert-image | ImageSize = 200px | ImageAlt = | PIN = 1-Methyl-2-[(''E'')-2-(3-methylthiophen-2-yl)ethen-1-yl]-1,4,5,6-tetrahydropyrimidine | OtherNames = Morantel tartrate; Paratect | Section1 = {{Chembox Identifiers | CASNo = 20574-50-9 | CASNo_Ref = {{Cascite|correct|CAS}} | ChEBI = 94736 | ChEMBL = 1240978 | ChemSpiderID1 = 4101 | EC_number = 243-890-8 | KEGG = C08230 | PubChem = 5353792 | UNII = 7NJ031HAX5 | StdInChI=1S/C12H16N2S/c1-10-6-9-15-11(10)4-5-12-13-7-3-8-14(12)2/h4-6,9H,3,7-8H2,1-2H3/b5-4+ | StdInChIKey = NVEPPWDVLBMNMB-SNAWJCMRSA-N | SMILES = CC1=C(SC=C1)C=CC2=NCCCN2C }} | Section2 = {{Chembox Properties | C=12|H=16|N=2|S=1 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Morantel''' is an anthelmintic drug used for the removal of parasitic worms in livestock. It affects the nervous system of worms given the drug is an inhibitor of acetylcholinesterase.<ref>{{Cite web |url=http://parasitipedia.net/index.php?option=com_content&view=article&id=2706&Itemid=3007 |title=MORANTEL: SAFETY SUMMARY for VETERINARY use in Cattle, Sheep, Goats, and Horses. Poisoning, intoxication, overdose, antidote |website=PARASITIPEDIA.net|access-date=2018-02-21}}</ref> It is derived in part from 3-methylthiophene. Morantel is closely related to pyrantel.<ref name="Ullmann">{{cite book| first = Jonathan | last = Swanston |chapter = Thiophene | title = Ullmann's Encyclopedia of Industrial Chemistry | publisher = Wiley-VCH | location = Weinheim | date = 2006 | doi = 10.1002/14356007.a26_793.pub2| isbn = 3527306730 }}.</ref>

==References== {{reflist}}

Category:Anthelmintics Category:Veterinary drugs Category:Thiophenes Category:Pyrimidines

{{gastrointestinal-drug-stub}} {{Livestock-stub}}