{{short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 462252797 | IUPAC_name = (−)-(2''S'',3a,7a-''cis'')-α-Benzylhexahydro-γ-oxo-2-isoindolinebutyric acid | image = Mitiglinide.svg | image_class = skin-invert-image
<!--Clinical data--> | tradename = Glufast | Drugs.com = {{drugs.com|international|mitiglinide}} | routes_of_administration = By mouth (tablets)
<!--Identifiers--> | CAS_number_Ref = {{cascite|changed|??}} | CAS_number = 145375-43-5 | ATC_prefix = A10 | ATC_suffix = BX08 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 471498 | PubChem = 121891 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = DB01252 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 108739 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = D86I0XLB13 | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D01854
<!--Chemical data--> | C=19 | H=25 | N=1 | O=3 | smiles = O=C(O)[C@@H](Cc1ccccc1)CC(=O)N3C[C@H]2CCCC[C@H]2C3 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C19H25NO3/c21-18(20-12-15-8-4-5-9-16(15)13-20)11-17(19(22)23)10-14-6-2-1-3-7-14/h1-3,6-7,15-17H,4-5,8-13H2,(H,22,23)/t15-,16+,17-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = WPGGHFDDFPHPOB-BBWFWOEESA-N }}
'''Mitiglinide''' (INN,<ref name="INN">{{cite web|title=International Nonproprietary Names for Pharmaceutical Substances (INN). Recommended International Nonproprietary names (Rec. INN): List 40|url=https://www.who.int/medicines/publications/druginformation/innlists/PL78.pdf|publisher=World Health Organization|access-date=10 November 2016|page=187}}</ref> trade name '''Glufast''') is a drug for the treatment of type 2 diabetes.<ref name="pmid18803455">{{cite journal | vauthors = Malaisse WJ | title = Mitiglinide: a rapid- and short-acting non-sulfonylurea insulinotropic agent for the treatment of type 2 diabetic patients | journal = Expert Opinion on Pharmacotherapy | volume = 9 | issue = 15 | pages = 2691–8 | date = October 2008 | pmid = 18803455 | doi = 10.1517/14656566.9.15.2691 | s2cid = 73318104 }}</ref>
Mitiglinide belongs to the meglitinide (glinide) class of blood glucose-lowering drugs and is currently co-marketed in Japan by Kissei and Takeda. The North America rights to mitiglinide are held by Elixir Pharmaceuticals. Mitiglinide has not yet gained FDA approval.
==Pharmacology== Mitiglinide is thought to stimulate insulin secretion by closing the ATP-sensitive potassium K<sub>ATP</sub> channels in pancreatic β cells.
==Dosage== Mitiglinide is delivered in tablet form.
== References == {{reflist}}
== External links == * [http://www.elixirpharm.com/ Elixir Pharmaceuticals] — website of the U.S. rights holder for mitiglinide.
{{Oral hypoglycemics}} {{Ion channel modulators}}
Category:Carboxamides Category:Isoindoles Category:Meglitinides Category:Potassium channel blockers Category:Carboxylic acids