{{Short description|Chemical compound}} {{Drugbox | image = Metralindole structure.svg | image_class = skin-invert-image | width = 250px

<!--Clinical data--> | tradename = | pregnancy_category = | legal_status = Rx-only | routes_of_administration = Oral | class = Monoamine oxidase inhibitor (MAOI); Reversible inhibitor of MAO-A (RIMA) | ATC_prefix = None | ATC_suffix =

<!--Pharmacokinetic data--> | bioavailability = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | index2_label = HCl | CAS_number2_Ref = {{cascite|correct|CAS}} | CAS_number2 = 53734-79-5 | UNII2_Ref = {{fdacite|correct|FDA}} | UNII2 = M15TM76Y3L | CAS_number = 54188-38-4 | PubChem = 68713 | ChemSpiderID = 61964 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 2QW3FL6OPA

<!--Chemical data--> | IUPAC_name = 2,4,5,6-tetrahydro-9-methoxy-4-methyl-1''H''-3,4,6a-triazafluoranthene | C=15 | H=17 | N=3 | O=1 | SMILES = CN1CCN2C3=C(C=C(C=C3)OC)C4=C2C1=NCC4 }}

'''Metralindole''' ('''Inkazan''') is a reversible inhibitor of monoamine oxidase A (RIMA) which was investigated in Russia as a potential antidepressant.<ref name="pmid1884793">{{cite journal | vauthors = Andreeva NI, Golovina SM, Faermark MF, Shvarts GI, Mashkovskiĭ MD | title = [The comparative influence of pyrazidol, inkazan and other antidepressant monoamine oxidase inhibitors on the pressor effect of tyramine] | language = ru | journal = Farmakologiia i Toksikologiia | volume = 54 | issue = 2 | pages = 38–40 | year = 1991 | pmid = 1884793 }}</ref> It is structurally and pharmacologically related to pirlindole.

== See also == * Substituted β-carboline § Related compounds * Pirlindole * Tetrindole * List of Russian drugs

== References == {{Reflist}}

{{Antidepressants}} {{Anxiolytics}} {{Monoamine metabolism modulators}} {{Tryptamines}}

Category:Antidepressants Category:beta-Carbolines Category:N,N-Dialkyltryptamines Category:5-Methoxytryptamines Category:Monoamine oxidase inhibitors Category:Reversible inhibitors of MAO-A Category:Russian drugs

{{nervous-system-drug-stub}}