{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = 17β-Hydroxy-16,16-dimethylestr-4-en-3-one | image = Metogest.svg | image_class = skin-invert-image | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 52279-58-0 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = BPY4IK3W14 | ATC_prefix = None | ATC_suffix = | PubChem = 9839398 | DrugBank = | ChemSpiderID = 8015116 | C=20 | H=30 | O=2 | SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC([C@@H]2O)(C)C)CCC4=CC(=O)CC[C@H]34 | StdInChI = 1S/C20H30O2/c1-19(2)11-17-16-6-4-12-10-13(21)5-7-14(12)15(16)8-9-20(17,3)18(19)22/h10,14-18,22H,4-9,11H2,1-3H3/t14-,15+,16+,17-,18-,20-/m0/s1 | StdInChIKey = JYCITEUSLNKPHC-URNBORRASA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category= | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration = }}
'''Metogest''' (INN, USAN) (developmental code name '''SC-14207'''), also known as '''16,16-dimethyl-19-nortestosterone''', is a steroidal antiandrogen that was patented in 1975 and investigated as a treatment for acne but was never marketed.<ref name="Elks2014">{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA816|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=816–}}</ref><ref name="HillMakin1991">{{cite book| vauthors = Hill RA, Makin HL, Kirk DN, Murphy GM |title=Dictionary of Steroids|url=https://books.google.com/books?id=qw5X0NK1A90C&pg=PA676|date=23 May 1991|publisher=CRC Press|isbn=978-0-412-27060-4|pages=676–}}</ref><ref name="HorskyPresl2012">{{cite book| vauthors = Horsky J, Presl J |title=Ovarian Function and its Disorders: Diagnosis and Therapy|url=https://books.google.com/books?id=7IrpCAAAQBAJ&pg=PA112|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-009-8195-9|pages=112–}}</ref>
==See also== * Steroidal antiandrogen * List of steroidal antiandrogens
==References== {{Reflist|2}}
{{Androgen receptor modulators}}
Category:Anti-acne preparations Category:Estranes Category:Steroidal antiandrogens
{{Estrane-stub}} {{dermatologic-drug-stub}}