{{short description|Diuretic drug}} {{onesource|date=October 2024}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 376085993 | IUPAC_name = 6-Chloro-3-(chloromethyl)-2-methyl-3,4-dihydro-2''H''-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide | image = Methyclothiazide.svg | image_class = skin-invert-image <!--Clinical data--> | tradename = Enduron | Drugs.com = {{drugs.com|CDI|methyclothiazide}} | MedlinePlus = a682569 | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration = <!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = <!--Identifiers--> | IUPHAR_ligand = 7235 | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 135-07-9 | ATC_prefix = C03 | ATC_suffix = AA08 | PubChem = 4121 | DrugBank_Ref = {{drugbankcite|changed|drugbank}} | DrugBank = DB00232 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 3978 | UNII_Ref = {{fdacite|changed|FDA}} | UNII = L3H46UAC61 | KEGG_Ref = {{keggcite|changed|kegg}} | KEGG = D00656 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1577 <!--Chemical data--> | C=9 | H=11 | Cl=2 | N=3 | O=4 | S=2 | smiles = O=S(C1=CC(S(=O)(N(C(CCl)N2)C)=O)=C2C=C1Cl)(N)=O }}

'''Methyclothiazide''' (trade name '''Enduron''') is a thiazide diuretic.<ref>{{cite book | vauthors = Wirfs MJ |title=APRN and PAS complete guide to prescribing drug therapy 2022. |date=2022 |publisher=Springer |location=[S.l.] |isbn=978-0-8261-8549-5 | page = 366 | chapter = Hypertension: Primary Essential | chapter-url = https://books.google.com/books?id=np0tEAAAQBAJ&dq=Methyclothiazide&pg=PA366 }}</ref>

==References== {{Reflist}}

{{Symporter inhibitors}} {{Diuretics}}

Category:Diuretics Category:Sulfonamides Category:Benzothiadiazines Category:Organochlorides Category:Carbonic anhydrase inhibitors Category:Thiazides

{{cardiovascular-drug-stub}}